![2-[(4-Nitrophenyl)amino]ethanol structure, CAS 1965-54-4](/structures/40000/27742_1_1965_54_4.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1965-54-4 |
| Catalog No. | 2A-9027742 |
| Chinese Name | 2-[(4-硝基苯基)氨基]乙醇 |
| Synonyms | 2-[(4-nitrophenyl)amino]ethanol; SBB006779; 2-(p-Nitroanilino)ethanol; NCIOpen2_001906; NSC103357 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 221.24 |
| Purity | 96 |
| Density | 1.352g/cm3 |
| Boiling Point | 389.5ºC at 760mmHg |
| Melting Point | 283-287 °C |
| Appearance | solid |
| HTC | 2922199090 |
| PubChem ID | 24884358 |
| MDL Number | MFCD00170222 |
| SMILES | Nc1nc(cs1)-c2ccc(cc2)[N+]([O-])=O |
| InChI | 1S/C9H7N3O2S/c10-9-11-8(5-15-9)6-1-3-7(4-2-6)12(13)14/h1-5H,(H2,10,11) |
| InChI Key | RIKJWJIWXCUKQV-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/27742_1_1965_54_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| cis-1,2-Cyclohexanediol | 1792-81-0 | 2A-9027484 |
| Diphenylpiperidin-4-ylmethanol hydrochloride | 1798-50-1 | 2A-9027494 |
| 2,2,3-Trimethylcyclopent-3-ene-1-ethanol | 1901-38-8 | 2A-9027661 |
| N-Butyltoluene-4-sulfonamide | 1907-65-9 | 2A-9027667 |
| 4-Toluenesulfonyl bromide | 1950-69-2 | 2A-9027724 |
| 2,2,2-Trichloro-1-phenylethanol | 2000-43-3 | 2A-9027783 |
| 1,3,5-Cyclohexanetriol | 2041-15-8 | 2A-9027870 |
| 2,3,6-Trichlorotoluene | 2077-46-5 | 2A-9027948 |
| 1,1'-Azobis(cyanocyclohexane) | 2094-98-6 | 2A-9027969 |
| 4-Methylphenylacetone | 2096-86-8 | 2A-9027972 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA