
CAS Number2000-43-3
SynonymsEfiran 99; 1,1,1-trichloro-2-phenylethan-2-ol; MFCD00043571; 2,2':6',2''-TERPYRIDINE-4,4',4''-TRICARBOXYLIC ACID; 2,2,2-trichloro-1-phenylethan-1-ol; Phenyl(trichloromethyl)carbinol; EINECS 217-887-7; Trichloromethylphenyl carbinol; (±)-2,2,2-trichloro-1-phenylethanol; 1-phenyl-2,2,2-trichloro-ethanol
Molecular FormulaC6H5CH(OH)CD3
Molecular Weight125.18
Purity98.00%
Boiling Point204 °C/745 mmHg (lit.)
Melting Point19-20 °C (lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2000-43-3 |
| Catalog No. | 2A-9027783 |
| Chinese Name | 2,2,2-三氯-1-苯基乙醇 |
| Synonyms | Efiran 99; 1,1,1-trichloro-2-phenylethan-2-ol; MFCD00043571; 2,2':6',2''-TERPYRIDINE-4,4',4''-TRICARBOXYLIC ACID; 2,2,2-trichloro-1-phenylethan-1-ol; Phenyl(trichloromethyl)carbinol; EINECS 217-887-7; Trichloromethylphenyl carbinol; (±)-2,2,2-trichloro-1-phenylethanol; 1-phenyl-2,2,2-trichloro-ethanol |
| Molecular Formula | C6H5CH(OH)CD3 |
| Molecular Weight | 125.18 |
| Purity | 98.00 |
| Boiling Point | 204 °C/745 mmHg (lit.) |
| Melting Point | 19-20 °C (lit.) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2906299090 |
| PubChem ID | 24872651 |
| MDL Number | MFCD00084168 |
| SMILES | [2H]C([2H])([2H])C(O)c1ccccc1 |
| InChI | 1S/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3/i1D3 |
| InChI Key | WAPNOHKVXSQRPX-FIBGUPNXSA-N |
| UNSPSC | 12352202 |
| MSDS | msds/27783_1_2000_43_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2906299090 other aromatic alcohols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| Diphenylpiperidin-4-ylmethanol hydrochloride | 1798-50-1 | 2A-9027494 |
| 2,2,3-Trimethylcyclopent-3-ene-1-ethanol | 1901-38-8 | 2A-9027661 |
| N-Butyltoluene-4-sulfonamide | 1907-65-9 | 2A-9027667 |
| 4-Toluenesulfonyl bromide | 1950-69-2 | 2A-9027724 |
| 2-[(4-Nitrophenyl)amino]ethanol | 1965-54-4 | 2A-9027742 |
| 1,3,5-Cyclohexanetriol | 2041-15-8 | 2A-9027870 |
| 2,3,6-Trichlorotoluene | 2077-46-5 | 2A-9027948 |
| 1,1'-Azobis(cyanocyclohexane) | 2094-98-6 | 2A-9027969 |
| 4-Methylphenylacetone | 2096-86-8 | 2A-9027972 |
| 1-Phenyl-1-cyclohexanecarbonitrile | 2201-23-2 | 2A-9028135 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA