
CAS Number2050-49-9
Synonyms2,4-DIBROMO-1-NAPHTHOL; 2,4-dibromo-1-naphthalenol; 2,4-Dibrom-[1]naphthol; PSGUDVJPEWTBRM-UHFFFAOYSA; 2,4-Dibromonaphthalen-1-ol; 2.4-Dibrom-1-hydroxy-naphthalin; 1-Naphthalenol,2,4-dibromo; 2,4-dibromo-[1]naphthol; 2,3-DISTERAOYL-SN-GLYCERO-1-PHOSPHO-L-SERINE (MONOSODIUM SALT
Molecular FormulaC10H6Br2O
Molecular Weight301.967
Purity98.00%
Density1.956g/cm3
Boiling Point357ºC at 760mmHg
Melting Point107ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2050-49-9 |
| Catalog No. | 2A-9027899 |
| Chinese Name | 2,4-二溴-1-萘酚 |
| Synonyms | 2,4-DIBROMO-1-NAPHTHOL; 2,4-dibromo-1-naphthalenol; 2,4-Dibrom-[1]naphthol; PSGUDVJPEWTBRM-UHFFFAOYSA; 2,4-Dibromonaphthalen-1-ol; 2.4-Dibrom-1-hydroxy-naphthalin; 1-Naphthalenol,2,4-dibromo; 2,4-dibromo-[1]naphthol; 2,3-DISTERAOYL-SN-GLYCERO-1-PHOSPHO-L-SERINE (MONOSODIUM SALT |
| Molecular Formula | C10H6Br2O |
| Molecular Weight | 301.967 |
| Purity | 98.00 |
| Density | 1.956g/cm3 |
| Boiling Point | 357ºC at 760mmHg |
| Melting Point | 107ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2908199090 |
| PubChem ID | 72219 |
| MDL Number | MFCD00059130 |
| SMILES | Oc1c(Br)cc(Br)c2ccccc12 |
| InChI | InChI=1S/C10H6Br2O/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-5,13H |
| InChI Key | PSGUDVJPEWTBRM-UHFFFAOYSA-N |
| MSDS | msds/27899_1_2050_49_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2,4-Dibromo-1-naphthol Modification number: 5 |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| Dicamba | 1918-00-9 | 2A-9027685 |
| Octyl (2,4-dichlorophenoxy)acetate | 1928-44-5 | 2A-9027693 |
| Butoxyethyl (2,4-dichlorophenoxy)acetate | 1929-73-3 | 2A-9027696 |
| Dicamba sodium salt | 1982-69-0 | 2A-9027759 |
| N-Methyl-2,4-dinitroaniline | 2044-88-4 | 2A-9027882 |
| 2,4-Dichloro-5-fluoronitrobenzene | 2105-59-1 | 2A-9027985 |
| 4-Pyridylethylmercaptan | 2127-05-1 | 2A-9028018 |
| Ethyl 2,4-dimethyl-1H-pyrrole-3-carboxylate | 2199-51-1 | 2A-9028132 |
| Ethyl 5-formyl-2,4-dimethyl-1H-pyrrole-3-carboxylate | 2199-59-9 | 2A-9028134 |
| 2,4,5-Trifluorophenol | 2268-16-8 | 2A-9028240 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA