
CAS Number1928-44-5
SynonymsOctyl ester of 2,4-D; EINECS 217-674-9; 2,4-Dichlorphenoxyessigsaeure-n-octylester; octyl 2-(2,4-dichlorophenoxy)acetate; octyl (2,4-dichlorophenoxy)acetate; Octyl 2,4-dichlorophenoxyacetate; 2,4-Dichlorphenoxyacetic acid octyl ester; 2,4-D Octyl ester
Molecular FormulaC16H22Cl2O3
Molecular Weight333.25000
Purity98.00%
Density1.151g/cm3
Boiling Point401.7ºC at 760mmHg
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1928-44-5 |
| Catalog No. | 2A-9027693 |
| Chinese Name | 2,4-滴辛酯 |
| Synonyms | Octyl ester of 2,4-D; EINECS 217-674-9; 2,4-Dichlorphenoxyessigsaeure-n-octylester; octyl 2-(2,4-dichlorophenoxy)acetate; octyl (2,4-dichlorophenoxy)acetate; Octyl 2,4-dichlorophenoxyacetate; 2,4-Dichlorphenoxyacetic acid octyl ester; 2,4-D Octyl ester |
| Molecular Formula | C16H22Cl2O3 |
| Molecular Weight | 333.25000 |
| Purity | 98.00 |
| Density | 1.151g/cm3 |
| Boiling Point | 401.7ºC at 760mmHg |
| HTC | 2918990090 |
| PubChem ID | 119076 |
| SMILES | CCCCCCCCOC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H22Cl2O3/c1-2-3-4-5-6-7-10-20-16(19)12-21-15-9-8-13(17)11-14(15)18/h8-9,11H,2-7,10,12H2,1H3 |
| InChI Key | JWEDKKSQRXHXJD-UHFFFAOYSA-N |
| Hazard Symbols | 3.2 |
| MSDS | msds/27693_1_1928_44_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| L-2,4-Diaminobutyric acid hydrobromine | 1758-80-1 | 2A-9027427 |
| L-2,4-Diaminobutyric acid dihydrochloride | 1883-09-6 | 2A-9027632 |
| 2,4-Diaminoquinazoline | 1899-48-5 | 2A-9027659 |
| Paraquat dichloride | 1910-42-5 | 2A-9027671 |
| Dicamba | 1918-00-9 | 2A-9027685 |
| Butoxyethyl (2,4-dichlorophenoxy)acetate | 1929-73-3 | 2A-9027696 |
| Dicamba sodium salt | 1982-69-0 | 2A-9027759 |
| N-Methyl-2,4-dinitroaniline | 2044-88-4 | 2A-9027882 |
| 2,4-Dibromo-1-naphthol | 2050-49-9 | 2A-9027899 |
| 2,4-Dichloro-5-fluoronitrobenzene | 2105-59-1 | 2A-9027985 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA