
CAS Number2268-16-8
Synonyms2,4,5-Trifluorophenol 1GR; 2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOLE-5-BORONIC ACID,PINACOL ESTER; 2,4,5-Tfifluorophenol; 2,4,5-trifluoro-phenol; 2,4,5-Trifluorophenol; MFCD00061215; 2,4,5-Trifluor-phenol
Molecular FormulaC6H3F3O
Molecular Weight148.08
Purity98.00%
Density1.473 g/cm3
Boiling Point169.5ºC at 760 mmHg
Melting Point37-42 °C
AppearanceWhite crystalline powder or chunks
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2268-16-8 |
| Catalog No. | 2A-9028240 |
| Chinese Name | 2,4,5-三氟苯酚 |
| Synonyms | 2,4,5-Trifluorophenol 1GR; 2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOLE-5-BORONIC ACID,PINACOL ESTER; 2,4,5-Tfifluorophenol; 2,4,5-trifluoro-phenol; 2,4,5-Trifluorophenol; MFCD00061215; 2,4,5-Trifluor-phenol |
| Molecular Formula | C6H3F3O |
| Molecular Weight | 148.08 |
| Purity | 98.00 |
| Density | 1.473 g/cm3 |
| Boiling Point | 169.5ºC at 760 mmHg |
| Melting Point | 37-42 °C |
| Appearance | White crystalline powder or chunks |
| Storage Condition | Keep container sealed, placed in a tight-fitting c |
| Packaging | III |
| HTC | 29081000 |
| PubChem ID | 3152358 |
| SMILES | Oc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C6H3F3O/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H |
| InChI Key | ODGMYCITQAIRCI-UHFFFAOYSA-N |
| Hazard Symbols | 4.1 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dibromo-1-naphthol | 2050-49-9 | 2A-9027899 |
| 2,4-Dichloro-5-fluoronitrobenzene | 2105-59-1 | 2A-9027985 |
| 4-Pyridylethylmercaptan | 2127-05-1 | 2A-9028018 |
| Ethyl 2,4-dimethyl-1H-pyrrole-3-carboxylate | 2199-51-1 | 2A-9028132 |
| Ethyl 5-formyl-2,4-dimethyl-1H-pyrrole-3-carboxylate | 2199-59-9 | 2A-9028134 |
| Dicamba dimethylamine | 2300-66-5 | 2A-9028275 |
| N,N-Diethylchloroacetamide | 2315-36-8 | 2A-9028307 |
| 2,4-Decadienal | 2363-88-4 | 2A-9028362 |
| 3-Acetyl-2,4-dimethylpyrrole | 2386-25-6 | 2A-9028407 |
| Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate | 2436-79-5 | 2A-9028520 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA