CAS Number1955-46-0
Synonymsmono-Methyl 5-nitroisophthalate; EINECS 217-793-6; 5-Nitroisophthalic Acid Monomethyl Ester; methyl hydrogen 5-nitroisophthalate; mono-Methyl-5-nitroisophthalic acid; 3-(Methoxycarbonyl)-5-nitrobenzoic acid; MonoMethyl 5-Nitroisophthalate; 3-carbomethoxy-5-nitrobenzoic acid; 5-Nitroisophthalic acid,monomethyl ester; 1,3-Benzenedicarboxylic acid, 5-nitro-, monomethyl ester; Methyl 5-nitroisophthalate; 5-Nitro Monomethyl Isophthalate; 3-nitro-5-methoxycarbonylbenzoic acid; Monomethyl 5-nitrobenzene-1,3-dicarboxylate; MFCD00009793
Molecular FormulaC9H7NO6
Molecular Weight225.159
Purity98.00%
Density1.5±0.1 g/cm3
Boiling Point419.7±35.0 °C at 760 mmHg
Melting Point180-182 °C(lit.)
AppearanceSlightly yellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1955-46-0 |
| Catalog No. | 2A-9027733 |
| Chinese Name | 5-硝基间苯二甲酸单甲酯 |
| Synonyms | mono-Methyl 5-nitroisophthalate; EINECS 217-793-6; 5-Nitroisophthalic Acid Monomethyl Ester; methyl hydrogen 5-nitroisophthalate; mono-Methyl-5-nitroisophthalic acid; 3-(Methoxycarbonyl)-5-nitrobenzoic acid; MonoMethyl 5-Nitroisophthalate; 3-carbomethoxy-5-nitrobenzoic acid; 5-Nitroisophthalic acid,monomethyl ester; 1,3-Benzenedicarboxylic acid, 5-nitro-, monomethyl ester; Methyl 5-nitroisophthalate; 5-Nitro Monomethyl Isophthalate; 3-nitro-5-methoxycarbonylbenzoic acid; Monomethyl 5-nitrobenzene-1,3-dicarboxylate; MFCD00009793 |
| Molecular Formula | C9H7NO6 |
| Molecular Weight | 225.159 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 419.7±35.0 °C at 760 mmHg |
| Melting Point | 180-182 °C(lit.) |
| Appearance | Slightly yellow powder |
| Water Solubility | insoluble |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2942000000 |
| PubChem ID | 608858 |
| MDL Number | MFCD00157021 |
| SMILES | COC(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H7NO6/c1-16-9(13)6-2-5(8(11)12)3-7(4-6)10(14)15/h2-4H,1H3,(H,11,12) |
| InChI Key | ZCRNIIJXDRYWDU-UHFFFAOYSA-N |
| MSDS | msds/27733_1_1955_46_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,3-Dibromo-1,4-butanediol | 1947-58-6 | 2A-9027717 |
| Metrizoic acid | 1949-45-7 | 2A-9027721 |
| 2-Deoxy-D-galactose | 1949-89-9 | 2A-9027722 |
| 3,4,5,6-Tetrachlorophthalonitrile | 1953-99-7 | 2A-9027731 |
| Methyl 3-(chlorocarbonyl)-5-nitrobenzoate | 1955-04-0 | 2A-9027732 |
| 3-Chlorophenylalanine | 1956-15-6 | 2A-9027734 |
| 3-Hydroxytetradecanoic acid | 1961-72-4 | 2A-9027736 |
| 2-Chloroterephthalic acid | 1967-31-3 | 2A-9027743 |
| 2-Bromoethylbenzene | 1973-22-4 | 2A-9027746 |
| 2-Bromoheptane | 1974-04-5 | 2A-9027747 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS