
CAS Number1967-31-3
SynonymsEINECS 217-817-5; 2-chloro-terephthalic acid; Terephthalic acid,chloro; chloroterephthalic acid; 2-chloro-1,4-benzendicarboxylic acid; 2-chloro-1,4-benzenedicarboxylic acid
Molecular FormulaC8H5ClO4
Molecular Weight200.58
Purity98.00%
Density1.586g/cm3
Boiling Point400.5ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1967-31-3 |
| Catalog No. | 2A-9027743 |
| Chinese Name | 2-氯对苯二甲酸 |
| Synonyms | EINECS 217-817-5; 2-chloro-terephthalic acid; Terephthalic acid,chloro; chloroterephthalic acid; 2-chloro-1,4-benzendicarboxylic acid; 2-chloro-1,4-benzenedicarboxylic acid |
| Molecular Formula | C8H5ClO4 |
| Molecular Weight | 200.58 |
| Purity | 98.00 |
| Density | 1.586g/cm3 |
| Boiling Point | 400.5ºC at 760mmHg |
| Storage Condition | Room temperature, dry, sealed |
| HTC | 2915900090 |
| PubChem ID | 83131 |
| SMILES | O=C(O)c1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C8H5ClO4/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| InChI Key | ZPXGNBIFHQKREO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4,5,6-Tetrachlorophthalonitrile | 1953-99-7 | 2A-9027731 |
| Methyl 3-(chlorocarbonyl)-5-nitrobenzoate | 1955-04-0 | 2A-9027732 |
| Methyl 5-nitroisophthalate | 1955-46-0 | 2A-9027733 |
| 3-Chlorophenylalanine | 1956-15-6 | 2A-9027734 |
| 3-Hydroxytetradecanoic acid | 1961-72-4 | 2A-9027736 |
| 2-Bromoethylbenzene | 1973-22-4 | 2A-9027746 |
| 2-Bromoheptane | 1974-04-5 | 2A-9027747 |
| 2-Methyl-4-nitrobenzoic acid | 1975-51-5 | 2A-9027750 |
| 2-Methyl-5-nitrobenzoic acid | 1975-52-6 | 2A-9027751 |
| 5-Fluoro-2-methoxyaniline | 1978-39-8 | 2A-9027754 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA