CAS Number1948-40-9
Synonyms4-Hydroxy-3,5-dijod-benzaldehyd; VHR DQ CI EI; EINECS 217-754-3; MFCD00014670; 2,6-Diiodo-4-formylphenol; 3,5-Diiodo-4-hydroxybenzaldehyde; 4-hydroxy-3,5-diiodo-benzaldehyde; 4-Hydroxy-3,5-diiodobenzaldehyde; 3.5-Dijod-4-oxy-benzaldehyd
Molecular FormulaC7H4O2I2
Molecular Weight373.92
Purity98.00%
Density2.6±0.1 g/cm3
Boiling Point284.1±40.0 °C at 760 mmHg
Melting Point202-203°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1948-40-9 |
| Catalog No. | 2A-9027720 |
| Chinese Name | 3,5-二碘-4-羟基苯甲醛 |
| Synonyms | 4-Hydroxy-3,5-dijod-benzaldehyd; VHR DQ CI EI; EINECS 217-754-3; MFCD00014670; 2,6-Diiodo-4-formylphenol; 3,5-Diiodo-4-hydroxybenzaldehyde; 4-hydroxy-3,5-diiodo-benzaldehyde; 4-Hydroxy-3,5-diiodobenzaldehyde; 3.5-Dijod-4-oxy-benzaldehyd |
| Molecular Formula | C7H4O2I2 |
| Molecular Weight | 373.92 |
| Purity | 98.00 |
| Density | 2.6±0.1 g/cm3 |
| Boiling Point | 284.1±40.0 °C at 760 mmHg |
| Melting Point | 202-203°C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2913000090 |
| PubChem ID | 115399 |
| MDL Number | MFCD00014670 |
| SMILES | O=Cc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C7H4I2O2/c8-5-1-4(3-10)2-6(9)7(5)11/h1-3,11H |
| InChI Key | WHLUEIMENHLCMY-UHFFFAOYSA-N |
| MSDS | msds/27720_1_1948_40_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1-Bromo-3-(bromomethyl)adamantane | 1822-25-9 | 2A-9027523 |
| 3-Bromo-2-hydroxybenzaldehyde | 1829-34-1 | 2A-9027543 |
| Dimethyl 1,3-acetonedicarboxylate | 1830-54-2 | 2A-9027544 |
| 2-(Trifluoromethyl)benzenesulfonamide | 1869-24-5 | 2A-9027600 |
| 3'-Trifluoromethylisobutyranilide | 1939-27-1 | 2A-9027704 |
| Diethyl azodicarboxylate | 1972-28-7 | 2A-9027745 |
| 5-Nitronaphthalene-1-carboxylic acid | 1975-44-6 | 2A-9027748 |
| Fluorotributyltin | 1983-10-4 | 2A-9027760 |
| 2-Bromo-1-[3-(trifluoromethyl)phenyl]-1-ethanone | 2003-10-3 | 2A-9027792 |
| 1,8-Bis(bromomethyl)naphthalene | 2025-95-8 | 2A-9027825 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS