
CAS Number1822-25-9
SynonymsF0020-1605; MFCD00185299; 1-Brom-3-(brommethyl)adamantan; bromo-1 bromomethyl-3 adamantane; 1-Brommethyl-3-brom-adamantan; 3-Brom-1-brommethyl-adamantan
Molecular FormulaC11H16Br2
Molecular Weight308.058
Purity98.00%
Density1.734g/cm3
Boiling Point312.1ºC at 760mmHg
Melting Point105-108ºC(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1822-25-9 |
| Catalog No. | 2A-9027523 |
| Chinese Name | 1-溴-3-(溴甲基)金刚烷 |
| Synonyms | F0020-1605; MFCD00185299; 1-Brom-3-(brommethyl)adamantan; bromo-1 bromomethyl-3 adamantane; 1-Brommethyl-3-brom-adamantan; 3-Brom-1-brommethyl-adamantan |
| Molecular Formula | C11H16Br2 |
| Molecular Weight | 308.058 |
| Purity | 98.00 |
| Density | 1.734g/cm3 |
| Boiling Point | 312.1ºC at 760mmHg |
| Melting Point | 105-108ºC(lit.) |
| Storage Condition | Store at room temperature in a cool and ventilated |
| HTC | 2903890090 |
| PubChem ID | 3201759 |
| MDL Number | MFCD00185299 |
| SMILES | BrCC12CC3CC(CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C11H16Br2/c12-7-10-2-8-1-9(3-10)5-11(13,4-8)6-10/h8-9H,1-7H2 |
| InChI Key | SKQVGBXLHPBGHY-UHFFFAOYSA-N |
| MSDS | msds/27523_1_1822_25_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclootherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Hydroxy-5-iodobenzaldehyde | 1761-62-2 | 2A-9027433 |
| 4-Fluorobenzeneboronic acid | 1765-93-1 | 2A-9027441 |
| 4-Aminocyclohexanecarboxylic acid | 1776-53-0 | 2A-9027454 |
| 7-Bromo-3-hydroxynaphthalene-2-carboxylic acid | 1779-11-9 | 2A-9027459 |
| Methylglyoxime | 1804-15-5 | 2A-9027498 |
| 3-Bromo-2-hydroxybenzaldehyde | 1829-34-1 | 2A-9027543 |
| Dimethyl 1,3-acetonedicarboxylate | 1830-54-2 | 2A-9027544 |
| 2-(Trifluoromethyl)benzenesulfonamide | 1869-24-5 | 2A-9027600 |
| 3'-Trifluoromethylisobutyranilide | 1939-27-1 | 2A-9027704 |
| 3,5-Diiodo-4-hydroxybenzaldehyde | 1948-40-9 | 2A-9027720 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA