![2-Bromo-1-[3-(trifluoromethyl)phenyl]-1-ethanone structure, CAS 2003-10-3](/structures/40000/27792_2_2003_10_3.png)
CAS Number2003-10-3
Synonyms2-Bromo-1-[3-(trifluoromethyl)phenyl]-1-ethanone; 3'-(Trifluoromethyl)phenacyl bromide; 3-trifluoromethylphenacyl bromide; 2-bromo-1-[3-(trifluoromethyl)phenyl]ethan-1-one; MFCD03094283; 2-Bromo-1-[3-(trifluoromethyl)phenyl]ethanone; FXFFR CV1E; m-(Trifluoromethyl)phenacyl Bromide; 2-bromo-1-(3-(trifluoromethyl)phenyl)ethanone
Molecular FormulaC9H6BrF3O
Molecular Weight267.05
Purity98.00%
Density1.6±0.1 g/cm3
Boiling Point232.4±35.0 °C at 760 mmHg
Melting Point22ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2003-10-3 |
| Catalog No. | 2A-9027792 |
| Chinese Name | 2-溴-3-(三氟甲基)苯乙酮 |
| Synonyms | 2-Bromo-1-[3-(trifluoromethyl)phenyl]-1-ethanone; 3'-(Trifluoromethyl)phenacyl bromide; 3-trifluoromethylphenacyl bromide; 2-bromo-1-[3-(trifluoromethyl)phenyl]ethan-1-one; MFCD03094283; 2-Bromo-1-[3-(trifluoromethyl)phenyl]ethanone; FXFFR CV1E; m-(Trifluoromethyl)phenacyl Bromide; 2-bromo-1-(3-(trifluoromethyl)phenyl)ethanone |
| Molecular Formula | C9H6BrF3O |
| Molecular Weight | 267.05 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 232.4±35.0 °C at 760 mmHg |
| Melting Point | 22ºC |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| PubChem ID | 3215324 |
| SMILES | O=C(CBr)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6BrF3O/c10-5-8(14)6-2-1-3-7(4-6)9(11,12)13/h1-4H,5H2 |
| InChI Key | TZIYNLSEBAYCBZ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3'-Trifluoromethylisobutyranilide | 1939-27-1 | 2A-9027704 |
| 3,5-Diiodo-4-hydroxybenzaldehyde | 1948-40-9 | 2A-9027720 |
| Diethyl azodicarboxylate | 1972-28-7 | 2A-9027745 |
| 5-Nitronaphthalene-1-carboxylic acid | 1975-44-6 | 2A-9027748 |
| Fluorotributyltin | 1983-10-4 | 2A-9027760 |
| 1,8-Bis(bromomethyl)naphthalene | 2025-95-8 | 2A-9027825 |
| Dichloroglyoxime | 2038-44-0 | 2A-9027853 |
| 2-(Trifluoromethyl)cinnamic acid | 2062-26-2 | 2A-9027929 |
| 2-Bromomalonaldehyde | 2065-75-0 | 2A-9027935 |
| 2,7-Naphthalenedicarboxylic acid | 2089-89-6 | 2A-9027962 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS