CAS Number1878-88-2
SynonymsM-NITROPHENOXYACETIC ACID; (3-Nitrophenoxy)acetic acid; (3-Nitro-phenoxy)-essigsaeure; 3-Nitrophenoxyacetic Acid; O-(3-Nitro-phenyl)-glykolsaeure; 3-Nitro-phenylaetherglykolsaeure
Molecular FormulaC8H7NO5
Molecular Weight197.149
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point389.6±17.0 °C at 760 mmHg
Melting Point156-161ºC
AppearanceYellow-beige crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1878-88-2 |
| Catalog No. | 2A-9027625 |
| Chinese Name | 3-硝基苯氧基乙酸 |
| Synonyms | M-NITROPHENOXYACETIC ACID; (3-Nitrophenoxy)acetic acid; (3-Nitro-phenoxy)-essigsaeure; 3-Nitrophenoxyacetic Acid; O-(3-Nitro-phenyl)-glykolsaeure; 3-Nitro-phenylaetherglykolsaeure |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.149 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 389.6±17.0 °C at 760 mmHg |
| Melting Point | 156-161ºC |
| Appearance | Yellow-beige crystalline powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2918990090 |
| PubChem ID | 449448 |
| MDL Number | MFCD00059826 |
| SMILES | O=C(O)COc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H7NO5/c10-8(11)5-14-7-3-1-2-6(4-7)9(12)13/h1-4H,5H2,(H,10,11) |
| InChI Key | BNRRQAASFDGMMQ-UHFFFAOYSA-N |
| MSDS | msds/27625_1_1878_88_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3-Nitrophenoxyacetic acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Methoxyphenoxyacetic acid | 1877-75-4 | 2A-9027615 |
| 3-Aminobenzylalcohol | 1877-77-6 | 2A-9027616 |
| 2-Methyl-1-butanethiol | 1878-18-8 | 2A-9027617 |
| 3-Bromophenylacetic acid | 1878-67-7 | 2A-9027620 |
| 2-Nitrophenoxyacetic acid | 1878-87-1 | 2A-9027624 |
| 5-Methoxy-2-nitrobenzoic acid | 1882-69-5 | 2A-9027630 |
| 6-Hydroxy-2-methylquinazolin-4(3H)-one | 1882-77-5 | 2A-9027631 |
| Furfuryl isopropyl sulfide | 1883-78-9 | 2A-9027634 |
| 4-Methoxyphthalic acid | 1885-13-8 | 2A-9027636 |
| Phenyl chloroformate | 1885-14-9 | 2A-9027637 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS