
CAS Number1877-75-4
SynonymsEINECS 217-513-2; MFCD00014360; 4-Methoxyphenoxyacetic acid; 2-(4-Methoxyphenoxy)acetic acid; (4-Methoxyphenoxy)acetic acid; Acetic acid,(p-methoxyphenoxy); Acetic acid,(4-methoxyphenoxy); P-methoxyphenoxyacetic acid; 2-(p-methoxyphenoxy)acetic acid
Molecular FormulaC9H10O4
Molecular Weight182.178
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point328.0±17.0 °C at 760 mmHg
Melting Point112-114 °C
Appearancewhite crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1877-75-4 |
| Catalog No. | 2A-9027615 |
| Chinese Name | 对甲氧基苯氧乙酸 |
| Synonyms | EINECS 217-513-2; MFCD00014360; 4-Methoxyphenoxyacetic acid; 2-(4-Methoxyphenoxy)acetic acid; (4-Methoxyphenoxy)acetic acid; Acetic acid,(p-methoxyphenoxy); Acetic acid,(4-methoxyphenoxy); P-methoxyphenoxyacetic acid; 2-(p-methoxyphenoxy)acetic acid |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.178 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 328.0±17.0 °C at 760 mmHg |
| Melting Point | 112-114 °C |
| Appearance | white crystal |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2918990090 |
| PubChem ID | 70603 |
| MDL Number | MFCD00014360 |
| SMILES | COc1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C9H10O4/c1-12-7-2-4-8(5-3-7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChI Key | BHFSBJHPPFJCOS-UHFFFAOYSA-N |
| MSDS | msds/27615_1_1877_75_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sebaconitrile | 1871-96-1 | 2A-9027606 |
| 4-Chlorophenethylalcohol | 1875-88-3 | 2A-9027610 |
| 3-Methylphenethyl alcohol | 1875-89-4 | 2A-9027611 |
| Mono-methyl isophthalate | 1877-71-0 | 2A-9027612 |
| 3-Nitrophenylacetic acid | 1877-73-2 | 2A-9027614 |
| 3-Aminobenzylalcohol | 1877-77-6 | 2A-9027616 |
| 2-Methyl-1-butanethiol | 1878-18-8 | 2A-9027617 |
| 3-Bromophenylacetic acid | 1878-67-7 | 2A-9027620 |
| 2-Nitrophenoxyacetic acid | 1878-87-1 | 2A-9027624 |
| 3-Nitrophenoxyacetic acid | 1878-88-2 | 2A-9027625 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA