CAS Number1882-69-5
Synonyms2-nitro-5-methoxy-benzoic acid; WNR BVQ DO1; 5-methoxy-4-nitrobenzoic acid; MFCD00151836; 6-Nitro-m-anisic Acid; 5-methoxy-2-nirobenzoic acid; 5-Methoxy-2-nitrobenzoic acid
Molecular FormulaCH3OC6H3(NO2)CO2H
Molecular Weight197.14
Purity97%
Density1.4±0.1 g/cm3
Boiling Point399.7±27.0 °C at 760 mmHg
Melting Point125-130 °C (lit.)
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1882-69-5 |
| Catalog No. | 2A-9027630 |
| Chinese Name | 5-甲氧基-2-硝基苯甲酸 |
| Synonyms | 2-nitro-5-methoxy-benzoic acid; WNR BVQ DO1; 5-methoxy-4-nitrobenzoic acid; MFCD00151836; 6-Nitro-m-anisic Acid; 5-methoxy-2-nirobenzoic acid; 5-Methoxy-2-nitrobenzoic acid |
| Molecular Formula | CH3OC6H3(NO2)CO2H |
| Molecular Weight | 197.14 |
| Purity | 97 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 399.7±27.0 °C at 760 mmHg |
| Melting Point | 125-130 °C (lit.) |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2942000000 |
| PubChem ID | 24864416 |
| MDL Number | MFCD00151836 |
| SMILES | COc1ccc(c(c1)C(O)=O)[N+]([O-])=O |
| InChI | 1S/C8H7NO5/c1-14-5-2-3-7(9(12)13)6(4-5)8(10)11/h2-4H,1H3,(H,10,11) |
| InChI Key | URADKXVAIGMTEG-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/27630_1_1882_69_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Aminobenzylalcohol | 1877-77-6 | 2A-9027616 |
| 2-Methyl-1-butanethiol | 1878-18-8 | 2A-9027617 |
| 3-Bromophenylacetic acid | 1878-67-7 | 2A-9027620 |
| 2-Nitrophenoxyacetic acid | 1878-87-1 | 2A-9027624 |
| 3-Nitrophenoxyacetic acid | 1878-88-2 | 2A-9027625 |
| 6-Hydroxy-2-methylquinazolin-4(3H)-one | 1882-77-5 | 2A-9027631 |
| Furfuryl isopropyl sulfide | 1883-78-9 | 2A-9027634 |
| 4-Methoxyphthalic acid | 1885-13-8 | 2A-9027636 |
| Phenyl chloroformate | 1885-14-9 | 2A-9027637 |
| 3,4,5-Trimethoxybenzonitrile | 1885-35-4 | 2A-9027639 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS