
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1405-89-6 |
| Catalog No. | 2A-9026766 |
| Chinese Name | 杆菌肽锌 |
| Synonyms | Bacitracin zinc; EINECS 215-787-8; Bacitracin zinc salt; MFCD00130598; Bacitracin (Zinc) |
| Molecular Formula | C66H101N17O16SZn |
| Molecular Weight | 1486.07 |
| Purity | 98.00 |
| Melting Point | 250 °C (dec.) (lit.) |
| Appearance | powder |
| Water Solubility | 5.1 g/L (28 ºC) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Application | Bacitracin Zinc is a dephosphorylated product of C55-isoprenyl pyrophosphate, which inhibits the cleavage of Tyr from Met-enkephalin with an IC50 of 10 μM. |
| EINECS | 215-787-8 |
| PubChem ID | 57653938 |
| MDL Number | MFCD00130598 |
| SMILES | [Zn++].CCC(C)C(N)C1=NCC(S1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CCC([O-])=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@H]2CCCCNC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](CC([O-])=O)NC(=O)[C@H](Cc3cnc[nH]3)NC(=O)[C@@H](Cc4ccccc4)NC(=O)[C@@H](NC(=O)[C@@H](CCCN)NC2=O)[C@@H](C)CC |
| InChI | 1S/C66H103N17O16S.Zn/c1-9-35(6)52(69)66-72-32-48(100-66)63(97)80-43(26-34(4)5)59(93)75-42(22-23-50(85)86)58(92)83-53(36(7)10-2)64(98)76-40-20-15-16-25-71-55(89)46(29-49(68)84)78-62(96)47(30-51(87)88)79-61(95)45(28-39-31-70-33-73-39)77-60(94)44(27-38-18-13-12-14-19-38)81-65(99)54(37(8)11-3)82-57(91)41(21-17-24-67)74-56(40)90;/h12-14,18-19,31,33-37,40-48,52-54H,9-11,15-17,20-30,32,67,69H2,1-8H3,(H2,68,84)(H,70,73)(H,71,89)(H,74,90)(H,75,93)(H,76,98)(H,77,94)(H,78,96)(H,79,95)(H,80,97)(H,81,99)(H,82,91)(H,83,92)(H,85,86)(H,87,88);/q;+2/p-2/t35?,36-,37-,40-,41+,42+,43-,44+,45-,46-,47+,48?,52?,53-,54-;/m0./s1 |
| InChI Key | NKULICGUDKGGRL-FCHFGNCGSA-L |
| NACRES Code | NA.85 |
| UNSPSC | 51282002 |
| MSDS | msds/26766_1_1405_89_6.pdf |
| Transport Info | Product name: Bacitracin zinc |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Orcein | 1400-62-0 | 2A-9026751 |
| Capastat sulfate | 1405-37-4 | 2A-9026759 |
| Gentamycin sulfate | 1405-41-0 | 2A-9026760 |
| Tylosin tartrate | 1405-54-5 | 2A-9026762 |
| Bacitracin | 1405-87-4 | 2A-9026765 |
| Angiotensin | 1407-47-2 | 2A-9026768 |
| Nisin | 1414-45-5 | 2A-9026769 |
| Aloin | 1415-73-2 | 2A-9026770 |
| Humic acid | 1415-93-6 | 2A-9026771 |
| 2-Dimethylaminoethyl acetate | 1421-89-2 | 2A-9026775 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA