
CAS Number1241-94-7
Synonyms2-Ethylhexyl diphenyl phosphate; Diphenyl 2-ethylhexyl phosphate; 2-Ethylhexyldiphenylphosphate; phosphoric acid diphenyl 2-ethyl-hexyl ester; Santicizer 141; EINECS 214-987-2; MFCD00059949; Phosflex(R)362; Phosphoric acid,2-ethylhexyl diphenyl ester; 2-Ethylhexyldiphenyl phosphate; Octicizer; phosphoric acid-(2-ethyl-hexyl ester)-diphenyl ester; Phosphoric acid, 2-ethylhexyl diphenyl ester; Octyl Diphenyl Phosphate; Phosphoric Acid 2-Ethylhexyl Diphenyl Ester; Phosphorsaeure-(2-aethyl-hexylester)-diphenylester; Phosphoric Acid Octyl Diphenyl Ester; 2-ethylhexyl,diphenyl ester; Phosphoric Acid Diphenyl 2-Ethylhexyl Ester
Molecular FormulaC20H27O4P
Molecular Weight130.23
Purity95.00%
Density1.1±0.1 g/cm3
Boiling Point>180 °C/1013 hPa (decomposes)
Melting Point-54°C
Appearanceliquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1241-94-7 |
| Catalog No. | 2A-9026540 |
| Chinese Name | 2-乙基己基二苯基磷酸酯 |
| Synonyms | 2-Ethylhexyl diphenyl phosphate; Diphenyl 2-ethylhexyl phosphate; 2-Ethylhexyldiphenylphosphate; phosphoric acid diphenyl 2-ethyl-hexyl ester; Santicizer 141; EINECS 214-987-2; MFCD00059949; Phosflex(R)362; Phosphoric acid,2-ethylhexyl diphenyl ester; 2-Ethylhexyldiphenyl phosphate; Octicizer; phosphoric acid-(2-ethyl-hexyl ester)-diphenyl ester; Phosphoric acid, 2-ethylhexyl diphenyl ester; Octyl Diphenyl Phosphate; Phosphoric Acid 2-Ethylhexyl Diphenyl Ester; Phosphorsaeure-(2-aethyl-hexylester)-diphenylester; Phosphoric Acid Octyl Diphenyl Ester; 2-ethylhexyl,diphenyl ester; Phosphoric Acid Diphenyl 2-Ethylhexyl Ester |
| Molecular Formula | C20H27O4P |
| Molecular Weight | 130.23 |
| Purity | 95.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | >180 °C/1013 hPa (decomposes) |
| Melting Point | -54°C |
| Appearance | liquid |
| Water Solubility | Insoluble |
| Storage Condition | Store in a cool, ventilated warehouse |
| HTC | 2919900090 |
| PubChem ID | 8161101 |
| MDL Number | MFCD00040424 |
| SMILES | [P](=O)(O)(O)O.OCC(CCCC)CC |
| InChI | 1S/C8H18O.H3O4P/c1-3-5-6-8(4-2)7-9;1-5(2,3)4/h8-9H,3-7H2,1-2H3;(H3,1,2,3,4) |
| InChI Key | FZQYZMODYSBPES-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352106 |
| Hazard Symbols | 9.0 |
| MSDS | msds/26540_1_1241_94_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Levomepromazine hydrochloride | 1236-99-3 | 2A-9026535 |
| Furazabol | 1239-29-8 | 2A-9026536 |
| Epiandrosterone acetate | 1239-31-2 | 2A-9026537 |
| Ethidium bromide | 1239-45-8 | 2A-9026538 |
| 1-Caffeoylquinic acid | 1241-87-8 | 2A-9026539 |
| 7,12-Dihydroxycholest-4-en-3-one | 1254-03-1 | 2A-9026543 |
| Tris(pentafluorophenyl)phosphine | 1259-35-4 | 2A-9026547 |
| Paromomycin sulfate salt | 1263-89-4 | 2A-9026548 |
| Titanocene dichloride | 1271-19-8 | 2A-9026551 |
| Chromocene | 1271-24-5 | 2A-9026552 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA