
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1241-87-8 |
| Catalog No. | 2A-9026539 |
| Chinese Name | 1-咖啡酰奎宁酸 |
| Synonyms | Cyclohexanecarboxylicacid; 1-O-caffeoylquinic acid; 1-Kaffeylchinasaeure |
| Molecular Formula | C16H18O9 |
| Molecular Weight | 354.31 |
| Purity | ≥95.0 (HPLC) |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 636.2±55.0 °C at 760 mmHg |
| Application | 1-Caffeoylquinic acid 1-Caffeoylquinic acid is a potent NF-κB inhibitor that shows high binding affinity to the RH domain of p105 with a Ki value of 0.002 μM and a binding energy of 1.50 Kcal/mol. 1-C |
| PubChem ID | 15148157 |
| MDL Number | MFCD10566609 |
| SMILES | O=C(/C=C/C1=CC=C(O)C(O)=C1)O[C@@]2(C(O)=O)C[C@@H](O)[C@@H](O)[C@H](O)C2 |
| InChI | 1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(21)25-16(15(23)24)6-11(19)14(22)12(20)7-16/h1-5,11-12,14,17-20,22H,6-7H2,(H,23,24)/b4-2+/t11-,12-,14-,16+/m1/s1 |
| InChI Key | GWTUHAXUUFROTF-JUHZACGLSA-N |
| Beilstein/REAXYS | 3013403 |
| NACRES Code | NA.21 |
| UNSPSC | 41116107 |
| MSDS | msds/26539_1_1241_87_8.pdf |
| Transport Info | Product name: 1-caffeoylquinic acid |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Biperiden hydrochloride | 1235-82-1 | 2A-9026534 |
| Levomepromazine hydrochloride | 1236-99-3 | 2A-9026535 |
| Furazabol | 1239-29-8 | 2A-9026536 |
| Epiandrosterone acetate | 1239-31-2 | 2A-9026537 |
| Ethidium bromide | 1239-45-8 | 2A-9026538 |
| 2-Ethylhexyl diphenyl phosphate | 1241-94-7 | 2A-9026540 |
| 7,12-Dihydroxycholest-4-en-3-one | 1254-03-1 | 2A-9026543 |
| Tris(pentafluorophenyl)phosphine | 1259-35-4 | 2A-9026547 |
| Paromomycin sulfate salt | 1263-89-4 | 2A-9026548 |
| Titanocene dichloride | 1271-19-8 | 2A-9026551 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA