
CAS Number43229-01-2
Synonyms1-(4-(benzyloxy)-3-nitrophenyl)-2-bromoethanone; 2-bromo-1-(3-nitro-4-phenylmethoxyphenyl)ethanone; 2-Bromo-1-[3-nitro-4-(phenylmethoxy)phenyl]-ethanone; 1-[4-(Benzyloxy)-3-nitrophenyl]-2-bromoethanone; MFCD06797599
Molecular FormulaC15H12BrNO4
Molecular Weight260.04
Purity98%
Density1.5±0.1 g/cm3
Boiling Point465.2±35.0 °C at 760 mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 43229-01-2 |
| Catalog No. | 2A-9002612 |
| Chinese Name | 3'-硝基-4'-苄氧基-2-溴苯乙酮 |
| Synonyms | 1-(4-(benzyloxy)-3-nitrophenyl)-2-bromoethanone; 2-bromo-1-(3-nitro-4-phenylmethoxyphenyl)ethanone; 2-Bromo-1-[3-nitro-4-(phenylmethoxy)phenyl]-ethanone; 1-[4-(Benzyloxy)-3-nitrophenyl]-2-bromoethanone; MFCD06797599 |
| Molecular Formula | C15H12BrNO4 |
| Molecular Weight | 260.04 |
| Purity | 98 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 465.2±35.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | 2-8°C |
| HTC | 2914700090 |
| PubChem ID | 329815540 |
| MDL Number | MFCD03424358 |
| SMILES | Oc1ccc(cc1[N+]([O-])=O)C(=O)CBr |
| InChI | 1S/C8H6BrNO4/c9-4-8(12)5-1-2-7(11)6(3-5)10(13)14/h1-3,11H,4H2 |
| InChI Key | ADFUHIYILOQDHG-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/2612_1_43229_01_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromo-4,6-difluoroanisole | 202865-59-6 | 2A-9002607 |
| 2-Bromo-4,6-difluorobenzenesulphonyl chloride | 351003-42-4 | 2A-9002608 |
| 2-Bromo-4,6-difluoroiodobenzene | 175278-11-2 | 2A-9002609 |
| 2-Bromo-4,6-difluorophenol | 98130-56-4 | 2A-9002610 |
| 2-Bromo-4,6-dimethylaniline | 41825-73-4 | 2A-9002611 |
| 2-Bromo-4-chloro-6-fluoroaniline | 195191-47-0 | 2A-9002613 |
| 2-Bromo-4'-chloroacetophenone | 536-38-9 | 2A-9002614 |
| 2-Bromo-4-chloroacetophenone | 825-40-1 | 2A-9002615 |
| 2-Bromo-4-chloroaniline | 873-38-1 | 2A-9002616 |
| 2-Bromo-4-chloroanisole | 60633-25-2 | 2A-9002617 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA