
CAS Number60633-25-2
Synonyms2-Bromo-4-chloro-1-methoxybenzene; 2-Bromo-4-chlorophenyl methyl ether; MFCD00079705; 2-Bromo-4-chloro-anisole
Molecular FormulaC7H6BrClO
Molecular Weight221.479
Purity99%
Density1.6±0.1 g/cm3
Boiling Point238.5±20.0 °C at 760 mmHg
Melting Point28.6-29.1°C
AppearanceColorless transparent to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 60633-25-2 |
| Catalog No. | 2A-9002617 |
| Chinese Name | 2-溴-4-氯苯甲醚 |
| Synonyms | 2-Bromo-4-chloro-1-methoxybenzene; 2-Bromo-4-chlorophenyl methyl ether; MFCD00079705; 2-Bromo-4-chloro-anisole |
| Molecular Formula | C7H6BrClO |
| Molecular Weight | 221.479 |
| Purity | 99 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 238.5±20.0 °C at 760 mmHg |
| Melting Point | 28.6-29.1°C |
| Appearance | Colorless transparent to light yellow liquid |
| Storage Condition | Store in a sealed container in a cool, dry place |
| HTC | 2909309090 |
| SMILES | COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C7H6BrClO/c1-10-7-3-2-5(9)4-6(7)8/h2-4H,1H3 |
| InChI Key | YJEMGEBDXDPBSP-UHFFFAOYSA-N |
| Safety Description | S24/25 |
| MSDS | msds/2617_1_60633_25_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromo-4'-benzyloxy-3'-nitroacetophenone | 43229-01-2 | 2A-9002612 |
| 2-Bromo-4-chloro-6-fluoroaniline | 195191-47-0 | 2A-9002613 |
| 2-Bromo-4'-chloroacetophenone | 536-38-9 | 2A-9002614 |
| 2-Bromo-4-chloroacetophenone | 825-40-1 | 2A-9002615 |
| 2-Bromo-4-chloroaniline | 873-38-1 | 2A-9002616 |
| 2-Bromo-4-chlorobenzoic acid | 936-08-3 | 2A-9002618 |
| 2-Bromo-4'-chlorobenzophenone | 99585-64-5 | 2A-9002619 |
| 2-Bromo-4-chlorophenylacetic acid methyl ester | 24091-92-7 | 2A-9002620 |
| 2-Bromo-4-cyanophenol | 2315-86-8 | 2A-9002622 |
| 2-Bromo-4-fluoro-1-iodobenzene | 202865-73-4 | 2A-9002623 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA