
CAS Number98130-56-4
SynonymsMFCD00070752; 2-Bromo-4,6-difluorophenol; 2-Brom-4,6-difluor-phenol; QR BF DF FE
Molecular FormulaC6H3BrF2O
Molecular Weight208.988
Purity97%
Density1.9±0.1 g/cm3
Boiling Point177.5±35.0 °C at 760 mmHg
AppearanceColorless - light yellow transparent liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 98130-56-4 |
| Catalog No. | 2A-9002610 |
| Chinese Name | 2-溴-4,6-二氟苯酚 |
| Synonyms | MFCD00070752; 2-Bromo-4,6-difluorophenol; 2-Brom-4,6-difluor-phenol; QR BF DF FE |
| Molecular Formula | C6H3BrF2O |
| Molecular Weight | 208.988 |
| Purity | 97 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 177.5±35.0 °C at 760 mmHg |
| Appearance | Colorless - light yellow transparent liquid |
| Storage Condition | Sealed and stored in a cool, dry warehouse. Keep a |
| HTC | 2908199090 |
| SMILES | Oc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C6H3BrF2O/c7-4-1-3(8)2-5(9)6(4)10/h1-2,10H |
| InChI Key | YDRZYJATKMBSJX-UHFFFAOYSA-N |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S36/37/39 |
| MSDS | msds/2610_1_98130_56_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromo-4,6-dichlorobenzenesulfonylchloride | 351003-53-7 | 2A-9002605 |
| 2-Bromo-4,6-difluoroaniline hydrobromide | 101471-20-9 | 2A-9002606 |
| 2-Bromo-4,6-difluoroanisole | 202865-59-6 | 2A-9002607 |
| 2-Bromo-4,6-difluorobenzenesulphonyl chloride | 351003-42-4 | 2A-9002608 |
| 2-Bromo-4,6-difluoroiodobenzene | 175278-11-2 | 2A-9002609 |
| 2-Bromo-4,6-dimethylaniline | 41825-73-4 | 2A-9002611 |
| 2-Bromo-4'-benzyloxy-3'-nitroacetophenone | 43229-01-2 | 2A-9002612 |
| 2-Bromo-4-chloro-6-fluoroaniline | 195191-47-0 | 2A-9002613 |
| 2-Bromo-4'-chloroacetophenone | 536-38-9 | 2A-9002614 |
| 2-Bromo-4-chloroacetophenone | 825-40-1 | 2A-9002615 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA