CAS Number930-62-1
Synonyms2,4-dimethyl-imidazole; EINECS 213-221-4; 2,4-dimethyl; 2,4-Dimethyl-1H-imidazole; 1H-Imidazole,2,4-dimethyl; 2,4-Dimethylimidazol; 2-methyl-4-methylimidazole; 2,4-dimethyl-1(3)H-imidazole; 2,4-Dimethylimidazole; MFCD00022365; 2,5-Dimethyl-1H-imidazole; 2,4-Dimethyl-1(3)H-imidazol
Molecular FormulaC5H8N2
Molecular Weight96.130
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point273.7±9.0 °C at 760 mmHg
Melting Point85-87 °C
AppearanceLight yellow transparent liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 930-62-1 |
| Catalog No. | 2A-9025654 |
| Chinese Name | 2,4-二甲基咪唑 |
| Synonyms | 2,4-dimethyl-imidazole; EINECS 213-221-4; 2,4-dimethyl; 2,4-Dimethyl-1H-imidazole; 1H-Imidazole,2,4-dimethyl; 2,4-Dimethylimidazol; 2-methyl-4-methylimidazole; 2,4-dimethyl-1(3)H-imidazole; 2,4-Dimethylimidazole; MFCD00022365; 2,5-Dimethyl-1H-imidazole; 2,4-Dimethyl-1(3)H-imidazol |
| Molecular Formula | C5H8N2 |
| Molecular Weight | 96.130 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 273.7±9.0 °C at 760 mmHg |
| Melting Point | 85-87 °C |
| Appearance | Light yellow transparent liquid |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| Packaging | I; II; III |
| HTC | 2933290090 |
| SMILES | Cc1cnc(C)[nH]1 |
| InChI | InChI=1S/C5H8N2/c1-4-3-6-5(2)7-4/h3H,1-2H3,(H,6,7) |
| InChI Key | LLPKQRMDOFYSGZ-UHFFFAOYSA-N |
| MSDS | msds/25654_1_930_62_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dinitroiodobenzene | 709-49-9 | 2A-9025020 |
| Sodium 2,4-dimethylbenzenesulfonate | 827-21-4 | 2A-9025363 |
| 2,4-Dibromo-6-nitroaniline | 827-23-6 | 2A-9025364 |
| (2,4-Dimethoxyphenyl)acetone | 831-29-8 | 2A-9025387 |
| Allyl mercaptan | 870-23-5 | 2A-9025458 |
| 2,4-Diamino-6-(hydroxymethyl)pteridine | 945-24-4 | 2A-9025752 |
| 2,4-Dinitrodiphenylamine | 961-68-2 | 2A-9025792 |
| 2,4,5-Tribromo-1-methylimidazole | 1003-91-4 | 2A-9025879 |
| 1-(2,4-Dimethylphenyl)piperazine | 1013-76-9 | 2A-9025939 |
| Glyphosate | 1071-83-6 | 2A-9026017 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS