
CAS Number827-21-4
Synonyms2,4-dimethylbenzenesulfonic acid sodium salt; 2,4-Dimethylbenzenesulfonic; SODIUM M-XYLENE-4-SULFONATE; sodium m-xylenesulfonate; 2,4-dimethyl-benzenesulfonicacisodiumsalt; SODIUM2,4-DIMETHYLBENZENESULPHONATE; m-xylene-4-sulphonic acid sodium salt; EINECS 212-567-3; sodium m-xylene-4-sulphonate; sodium 2,4-xylene sulfonate; MFCD00041883; M-XYLENE-4-SULFONIC ACID SODIUM SALT; XYLENESULFONATE,SODIUMSALT
Molecular FormulaC8H9NaO3S
Molecular Weight208.21000
Purity98.00%
Melting Point112-116 °C(lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 827-21-4 |
| Catalog No. | 2A-9025363 |
| Chinese Name | 2,4-二甲苯磺酸钠 |
| Synonyms | 2,4-dimethylbenzenesulfonic acid sodium salt; 2,4-Dimethylbenzenesulfonic; SODIUM M-XYLENE-4-SULFONATE; sodium m-xylenesulfonate; 2,4-dimethyl-benzenesulfonicacisodiumsalt; SODIUM2,4-DIMETHYLBENZENESULPHONATE; m-xylene-4-sulphonic acid sodium salt; EINECS 212-567-3; sodium m-xylene-4-sulphonate; sodium 2,4-xylene sulfonate; MFCD00041883; M-XYLENE-4-SULFONIC ACID SODIUM SALT; XYLENESULFONATE,SODIUMSALT |
| Molecular Formula | C8H9NaO3S |
| Molecular Weight | 208.21000 |
| Purity | 98.00 |
| Melting Point | 112-116 °C(lit.) |
| Appearance | solid |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2904100000 |
| SMILES | Cc1ccc(S(=O)(=O)[O-])c(C)c1.[Na+] |
| InChI | InChI=1S/C8H10O3S.Na/c1-6-3-4-8(7(2)5-6)12(9,10)11;/h3-5H,1-2H3,(H,9,10,11);/q;+1/p-1 |
| InChI Key | GJQXYSKWRDJNAJ-UHFFFAOYSA-M |
| MSDS | msds/25363_2_827_21_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4,5-Trichloroaniline | 636-30-6 | 2A-9024644 |
| 2,4-Diphenylimidazole | 670-83-7 | 2A-9024802 |
| Dichloroacetamide | 683-72-7 | 2A-9024852 |
| 2,4-Diamino-6-fluoropyrimidine | 696-83-3 | 2A-9024921 |
| 2,4-Dinitroiodobenzene | 709-49-9 | 2A-9025020 |
| 2,4-Dibromo-6-nitroaniline | 827-23-6 | 2A-9025364 |
| (2,4-Dimethoxyphenyl)acetone | 831-29-8 | 2A-9025387 |
| Allyl mercaptan | 870-23-5 | 2A-9025458 |
| 2,4-Dimethylimidazole | 930-62-1 | 2A-9025654 |
| 2,4-Diamino-6-(hydroxymethyl)pteridine | 945-24-4 | 2A-9025752 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA