
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 718-08-1 |
| Catalog No. | 2A-9025041 |
| Chinese Name | 3-氧-4-苯基-丁酸乙酯 |
| Synonyms | 3-oxo-4-phenyl-butyric acid ethyl ester; Benzenebutanoic acid, β-oxo-, ethyl ester; Ethyl 3-oxo-4-phenylbutanoate |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.238 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 290.3±15.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918300090 |
| SMILES | CCOC(=O)CC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H14O3/c1-2-15-12(14)9-11(13)8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChI Key | BOZNWXQZCYZCSH-UHFFFAOYSA-N |
| MSDS | msds/25041_1_718_08_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Chlorophenanthrene | 715-51-5 | 2A-9025033 |
| 2,3-Naphthalenedicarboxylic anhydride | 716-39-2 | 2A-9025034 |
| 1,3,5-Triisopropylbenzene | 717-74-8 | 2A-9025038 |
| 3-Acetyl-5-nitrobenzoic acid | 717-75-9 | 2A-9025039 |
| 3,5-Dimethoxyphenylpropionic acid | 717-94-2 | 2A-9025040 |
| Ethylphenylcyano-acetic acid ethyl ester | 718-71-8 | 2A-9025042 |
| 2,6-Di-tert-butyl-p-benzoquinone | 719-22-2 | 2A-9025043 |
| 2-Amino-5-chlorobenzophenone | 719-59-5 | 2A-9025045 |
| Methyl 4-phenylbenzoate | 720-75-2 | 2A-9025049 |
| POVIDONE | 9003-39-8 | 2A-0200315 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA