
CAS Number717-94-2
SynonymsMFCD03425685; 3-(3,4-Dimethoxyphenyl)propanoic acid; 3-(3,5-Dimethoxyphenyl)propanoic acid; 3,5-Dimethoxyphenylpropionic acid
Molecular FormulaC11H14O4
Molecular Weight210.227
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point363.8±27.0 °C at 760 mmHg
Melting Point60-62ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 717-94-2 |
| Catalog No. | 2A-9025040 |
| Chinese Name | 3-(3,5-二甲氧基苯基)丙酸 |
| Synonyms | MFCD03425685; 3-(3,4-Dimethoxyphenyl)propanoic acid; 3-(3,5-Dimethoxyphenyl)propanoic acid; 3,5-Dimethoxyphenylpropionic acid |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.227 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 363.8±27.0 °C at 760 mmHg |
| Melting Point | 60-62ºC |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| SMILES | COc1cc(CCC(=O)O)cc(OC)c1 |
| InChI | InChI=1S/C11H14O4/c1-14-9-5-8(3-4-11(12)13)6-10(7-9)15-2/h5-7H,3-4H2,1-2H3,(H,12,13)/p-1 |
| InChI Key | LMBOJOXVLORKSQ-UHFFFAOYSA-N |
| MSDS | msds/25040_1_717_94_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Bromophenanthrene | 715-50-4 | 2A-9025032 |
| 3-Chlorophenanthrene | 715-51-5 | 2A-9025033 |
| 2,3-Naphthalenedicarboxylic anhydride | 716-39-2 | 2A-9025034 |
| 1,3,5-Triisopropylbenzene | 717-74-8 | 2A-9025038 |
| 3-Acetyl-5-nitrobenzoic acid | 717-75-9 | 2A-9025039 |
| Ethyl 4-phenylacetoacetate | 718-08-1 | 2A-9025041 |
| Ethylphenylcyano-acetic acid ethyl ester | 718-71-8 | 2A-9025042 |
| 2,6-Di-tert-butyl-p-benzoquinone | 719-22-2 | 2A-9025043 |
| 2-Amino-5-chlorobenzophenone | 719-59-5 | 2A-9025045 |
| Methyl 4-phenylbenzoate | 720-75-2 | 2A-9025049 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA