
CAS Number611-05-2
SynonymsEINECS 210-247-8; 3-Methyl-4-nitroaniline; 3-methyl-4-nitro-aniline; 4-nitro-3-methylaniline; 1-amino-3-methyl-4-nitrobenzene; 3-amino-6-nitrotoluene; 3-methyl-4-nitrophenylamine; 4-Nitro-m-toluidine; 5-amino-2-nitrotoluene; MFCD00091833
Molecular FormulaC21H18N2O3
Molecular Weight346.389
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point330.0±22.0 °C at 760 mmHg
Melting Point136-137°C
Appearancebrown crystalline solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 611-05-2 |
| Catalog No. | 2A-9024122 |
| Chinese Name | 3-甲基-4-硝基苯胺 |
| Synonyms | EINECS 210-247-8; 3-Methyl-4-nitroaniline; 3-methyl-4-nitro-aniline; 4-nitro-3-methylaniline; 1-amino-3-methyl-4-nitrobenzene; 3-amino-6-nitrotoluene; 3-methyl-4-nitrophenylamine; 4-Nitro-m-toluidine; 5-amino-2-nitrotoluene; MFCD00091833 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.389 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 330.0±22.0 °C at 760 mmHg |
| Melting Point | 136-137°C |
| Appearance | brown crystalline solid |
| Water Solubility | Soluble in: Tetrahydrofuran |
| Storage Condition | Storage: Seal the container and store it in a seal |
| Packaging | III |
| HTC | 2921430090 |
| MDL Number | MFCD00088709 |
| SMILES | Cc1cc(N)ccc1[N+]([O-])=O |
| InChI | InChI=1S/C7H8N2O2/c1-5-4-6(8)2-3-7(5)9(10)11/h2-4H,8H2,1H3 |
| InChI Key | InChIKey=XPAYEWBTLKOEDA-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/24122_1_611_05_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Item 1 Poisons. UN number: 2660 Official shipping name: Nitrotoluidine (monomer) Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Chloro-3-nitrophenol | 610-78-6 | 2A-9024112 |
| 5-Nitropseudocumene | 610-91-3 | 2A-9024114 |
| 2,5-Dihydroxyterephthalic acid | 610-92-4 | 2A-9024115 |
| Methyl 2-chlorobenzoate | 610-96-8 | 2A-9024117 |
| 2'-Hydroxypropiophenone | 610-99-1 | 2A-9024119 |
| 5-Chloro-2-nitrophenol | 611-07-4 | 2A-9024124 |
| 5-Nitroisatin | 611-09-6 | 2A-9024126 |
| 2-Chlorobenzyl bromide | 611-17-6 | 2A-9024130 |
| 2-Chlorobenzyl chloride | 611-19-8 | 2A-9024131 |
| Tectoridin | 611-40-5 | 2A-9024138 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA