CAS Number610-96-8
Synonyms2-Chloro-benzoic acid methyl ester; Benzoic acid, 2-chloro-, methyl ester; methyl monochlorobenzoate; Benzoic acid,2-chloro-,methyl ester; MFCD00016337; Benzoic acid,o-chloro-,methyl ester; Methyl 2-chlorobenzoate; methyl chlorobenzoate; methyl ortho-chlorobenzoate; Benzoic acid, o-chloro-, methyl ester; Methyl o-chlorobenzoate; 2-chlorobenzoic acid methyl ester; EINECS 210-242-0; Methyl-2-chlorobenzoate
Molecular FormulaC8H7ClO2
Molecular Weight170.593
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point225.4±13.0 °C at 760 mmHg
Melting Point233-235 °C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 610-96-8 |
| Catalog No. | 2A-9024117 |
| Chinese Name | 邻氯苯甲酸甲酯 |
| Synonyms | 2-Chloro-benzoic acid methyl ester; Benzoic acid, 2-chloro-, methyl ester; methyl monochlorobenzoate; Benzoic acid,2-chloro-,methyl ester; MFCD00016337; Benzoic acid,o-chloro-,methyl ester; Methyl 2-chlorobenzoate; methyl chlorobenzoate; methyl ortho-chlorobenzoate; Benzoic acid, o-chloro-, methyl ester; Methyl o-chlorobenzoate; 2-chlorobenzoic acid methyl ester; EINECS 210-242-0; Methyl-2-chlorobenzoate |
| Molecular Formula | C8H7ClO2 |
| Molecular Weight | 170.593 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 225.4±13.0 °C at 760 mmHg |
| Melting Point | 233-235 °C |
| Appearance | solid |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2916399090 |
| MDL Number | MFCD28976509 |
| SMILES | Clc1cc(c(cc1)Oc2ccc(cc2)C)C(=O)OC |
| InChI | 1S/C15H13ClO3/c1-10-3-6-12(7-4-10)19-14-8-5-11(16)9-13(14)15(17)18-2/h3-9H,1-2H3 |
| InChI Key | QFHRYWVFAVKILS-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/24117_1_610_96_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Nitrophenyl acetate | 610-69-5 | 2A-9024109 |
| 2,5-Dibromobenzoic acid | 610-71-9 | 2A-9024110 |
| 4-Chloro-3-nitrophenol | 610-78-6 | 2A-9024112 |
| 5-Nitropseudocumene | 610-91-3 | 2A-9024114 |
| 2,5-Dihydroxyterephthalic acid | 610-92-4 | 2A-9024115 |
| 2'-Hydroxypropiophenone | 610-99-1 | 2A-9024119 |
| 3-Methyl-4-nitroaniline | 611-05-2 | 2A-9024122 |
| 5-Chloro-2-nitrophenol | 611-07-4 | 2A-9024124 |
| 5-Nitroisatin | 611-09-6 | 2A-9024126 |
| 2-Chlorobenzyl bromide | 611-17-6 | 2A-9024130 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS