CAS Number610-69-5
Synonyms2-nitrobenzyl acetate; Acetic acid,2-nitrophenyl ester; Acetic acid,o-nitrophenyl ester; 2-nitrophenyl acetate; Nitrophenyl Acetate; 2-Nitrophenol acetate; o-Nitrophenyl acetate
Molecular FormulaC9H9NO4
Molecular Weight195.176
Purity98.00%
Density1.304g/cm3
Boiling Point141ºC/11 mmHg(lit.)
Melting Point39-41ºC(lit.)
AppearanceSolid or semi-solid or liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 610-69-5 |
| Catalog No. | 2A-9024109 |
| Chinese Name | 2-硝基苯基乙酸酯 |
| Synonyms | 2-nitrobenzyl acetate; Acetic acid,2-nitrophenyl ester; Acetic acid,o-nitrophenyl ester; 2-nitrophenyl acetate; Nitrophenyl Acetate; 2-Nitrophenol acetate; o-Nitrophenyl acetate |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.176 |
| Purity | 98.00 |
| Density | 1.304g/cm3 |
| Boiling Point | 141ºC/11 mmHg(lit.) |
| Melting Point | 39-41ºC(lit.) |
| Appearance | Solid or semi-solid or liquid |
| Storage Condition | 2-8°C, dry |
| HTC | 2915390090 |
| MDL Number | MFCD00092196 |
| SMILES | CC(=O)Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
| InChI Key | MRCKRGSNLOHYRA-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Nitroterephthalic acid | 610-29-7 | 2A-9024103 |
| 4-Hydroxyphthalic acid | 610-35-5 | 2A-9024104 |
| 4-Amino-2-nitrobenzoic acid | 610-36-6 | 2A-9024105 |
| 5-Hydroxy-2-nitrobenzoic acid | 610-37-7 | 2A-9024106 |
| 3,4-Dinitrochlorobenzene | 610-40-2 | 2A-9024107 |
| 2,5-Dibromobenzoic acid | 610-71-9 | 2A-9024110 |
| 4-Chloro-3-nitrophenol | 610-78-6 | 2A-9024112 |
| 5-Nitropseudocumene | 610-91-3 | 2A-9024114 |
| 2,5-Dihydroxyterephthalic acid | 610-92-4 | 2A-9024115 |
| Methyl 2-chlorobenzoate | 610-96-8 | 2A-9024117 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS