
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 610-37-7 |
| Catalog No. | 2A-9024106 |
| Chinese Name | 5-羟基-2-硝基苯甲酸 |
| Synonyms | 5-Hydroxy-2-nitrobenzoic acid; MFCD00017566 |
| Molecular Formula | C7H5NO5 |
| Molecular Weight | 183.12 |
| Purity | 98.00 |
| Density | 1.631 |
| Boiling Point | 455ºC at 760 mmHg |
| Melting Point | 170-171°C |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2918290000 |
| MDL Number | MFCD00017566 |
| SMILES | O=C(O)c1cc(O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5NO5/c9-4-1-2-6(8(12)13)5(3-4)7(10)11/h1-3,9H,(H,10,11) |
| InChI Key | BUHKQTKKZAXSMH-UHFFFAOYSA-N |
| MSDS | msds/24106_1_610_37_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 5-Hydroxy-2-nitrobenzoic acid Modification number: 6 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dimethyl 4-nitrophthalate | 610-22-0 | 2A-9024101 |
| 4-Nitrophthalic acid | 610-27-5 | 2A-9024102 |
| Nitroterephthalic acid | 610-29-7 | 2A-9024103 |
| 4-Hydroxyphthalic acid | 610-35-5 | 2A-9024104 |
| 4-Amino-2-nitrobenzoic acid | 610-36-6 | 2A-9024105 |
| 3,4-Dinitrochlorobenzene | 610-40-2 | 2A-9024107 |
| 2-Nitrophenyl acetate | 610-69-5 | 2A-9024109 |
| 2,5-Dibromobenzoic acid | 610-71-9 | 2A-9024110 |
| 4-Chloro-3-nitrophenol | 610-78-6 | 2A-9024112 |
| 5-Nitropseudocumene | 610-91-3 | 2A-9024114 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA