
CAS Number328-67-6
Synonyms3-Bromo-5-(trifluoromethyl)benzoic acid; 3-Bromo-5-trifluoromethyl-benzoic acid; 3-Bromo-5-trifluoromethylbenzoic acid; MFCD03412186
Molecular FormulaC8H4O2Br1F3
Molecular Weight269.02
Purity98.00%
Density1.8±0.1 g/cm3
Boiling Point284.3±40.0 °C at 760 mmHg
Melting Point132.3-132.8ºC
Appearancewhite to gray powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 328-67-6 |
| Catalog No. | 2A-9021302 |
| Chinese Name | 3-溴-5-三氟甲基苯甲酸 |
| Synonyms | 3-Bromo-5-(trifluoromethyl)benzoic acid; 3-Bromo-5-trifluoromethyl-benzoic acid; 3-Bromo-5-trifluoromethylbenzoic acid; MFCD03412186 |
| Molecular Formula | C8H4O2Br1F3 |
| Molecular Weight | 269.02 |
| Purity | 98.00 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 284.3±40.0 °C at 760 mmHg |
| Melting Point | 132.3-132.8ºC |
| Appearance | white to gray powder |
| Storage Condition | Room Temperature |
| HTC | 2916399090 |
| MDL Number | MFCD03412186 |
| SMILES | O=C(O)c1cc(Br)cc(C(F)(F)F)c1 |
| InChI Key | AMZBKZQMAZWIJM-UHFFFAOYSA-N |
| MSDS | msds/21302_1_328_67_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3-Bromo-5-(trifluoromethyl)benzoic acid |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Nitro-2-(trifluoromethyl)benzoic acid | 320-37-6 | 2A-9021245 |
| 4-Chloro-2-(trifluoromethyl)benzonitrile | 320-41-2 | 2A-9021246 |
| 4-Hydroxy-2-(trifluoromethyl)benzonitrile | 320-42-3 | 2A-9021247 |
| Benserazide | 322-35-0 | 2A-9021273 |
| 4-Fluorobenzene-1,3-dicarboxylic acid | 327-95-7 | 2A-9021296 |
| 3-Amino-5-(trifluoromethyl)benzoic acid | 328-68-7 | 2A-9021303 |
| 3-Hydroxy-5-trifluoromethylbenzoic acid | 328-69-8 | 2A-9021304 |
| 3,5-Bis(trifluoromethyl)bromobenzene | 328-70-1 | 2A-9021305 |
| 3-Nitro-5-(trifluoromethyl)benzoic acid | 328-80-3 | 2A-9021310 |
| 2-Bromo-4-(trifluoromethyl)benzoic acid | 328-89-2 | 2A-9021313 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA