CAS Number320-37-6
SynonymsMFCD04039246; 4-Nitro-2-(trifluoromethyl)benzoic acid; 4-nitro-2-trifluoromethyl-benzoic acid; 4-Nitro-2-trifluormethyl-benzoesaeure; RARECHEM AL BO 1444; 2-Carboxy-5-nitrobenzotrifluoride
Molecular FormulaO2NC6H3(CF3)CO2H
Molecular Weight235.12
Purity98%
Density1.6±0.1 g/cm3
Boiling Point321.4±42.0 °C at 760 mmHg
Melting Point134-138 °C (lit.)
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 320-37-6 |
| Catalog No. | 2A-9021245 |
| Chinese Name | 4-硝基-2-(三氟甲基)苯甲酸 |
| Synonyms | MFCD04039246; 4-Nitro-2-(trifluoromethyl)benzoic acid; 4-nitro-2-trifluoromethyl-benzoic acid; 4-Nitro-2-trifluormethyl-benzoesaeure; RARECHEM AL BO 1444; 2-Carboxy-5-nitrobenzotrifluoride |
| Molecular Formula | O2NC6H3(CF3)CO2H |
| Molecular Weight | 235.12 |
| Purity | 98 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 321.4±42.0 °C at 760 mmHg |
| Melting Point | 134-138 °C (lit.) |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2916399090 |
| PubChem ID | 24859755 |
| MDL Number | MFCD00007142 |
| SMILES | OC(=O)c1ccc(cc1[N+]([O-])=O)C(F)(F)F |
| InChI | 1S/C8H4F3NO4/c9-8(10,11)4-1-2-5(7(13)14)6(3-4)12(15)16/h1-3H,(H,13,14) |
| InChI Key | MYSAXQPTXWKDPQ-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1985588 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/21245_1_320_37_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Spiro[1,3-dioxolane-2,8'(9'H)-[7H-7,9a]methanobenz[a]azulene] | 171-00-6 | 2A-9021063 |
| 1,4-Cyclohexanedione bis(ethylene ketal) | 183-97-1 | 2A-9021065 |
| 2-Amino-3-trifluoromethylbenzoic acid | 313-12-2 | 2A-9021221 |
| 4-Bromomethyl-[2'-(2-Trityl-2h-Tetrazol-5-Yl)]Biphenyl | 2A-112658 | 2A-9021235 |
| 4-Bromo-2-(trifluoromethyl)benzoic acid | 320-31-0 | 2A-9021244 |
| 4-Chloro-2-(trifluoromethyl)benzonitrile | 320-41-2 | 2A-9021246 |
| 4-Hydroxy-2-(trifluoromethyl)benzonitrile | 320-42-3 | 2A-9021247 |
| Benserazide | 322-35-0 | 2A-9021273 |
| 4-Fluorobenzene-1,3-dicarboxylic acid | 327-95-7 | 2A-9021296 |
| 3-Bromo-5-(trifluoromethyl)benzoic acid | 328-67-6 | 2A-9021302 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS