
CAS Number147-82-0
Synonyms2,4,6-tribromobenzeneamine; 2,4,6-Tribromobenzenamine; Benzenamine,2,4,6-tribromo; ZR BE DE FE; Aniline,2,4,6-tribromo; 2,4,6-Tribromoaniline; 2,3-DIHYDRO-BENZO[1,4]DIOXINE-6-SULFONIC ACID (3-CHLORO-QUINOXALIN-2-YL)-AMIDE; sym-Tribromoaniline; EINECS 205-700-1; MFCD00007634; Aniline tribromide; s-Tribromoaniline; 2,4,6-tribromo-aniline; 2,4,6-Tribromophenylamine; 2,4,6-tribromaniline; (2,4,6-Tribromophenyl)amine
Molecular FormulaC6H4Br3N
Molecular Weight335.77
Purity98.00%
Density2.4±0.1 g/cm3
Boiling Point300.0±0.0 °C at 760 mmHg
Melting Point120-122 °C(lit.)
Appearancewhite crystal
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 147-82-0 |
| Catalog No. | 2A-9020975 |
| Chinese Name | 2,4,6-三溴苯胺 |
| Synonyms | 2,4,6-tribromobenzeneamine; 2,4,6-Tribromobenzenamine; Benzenamine,2,4,6-tribromo; ZR BE DE FE; Aniline,2,4,6-tribromo; 2,4,6-Tribromoaniline; 2,3-DIHYDRO-BENZO[1,4]DIOXINE-6-SULFONIC ACID (3-CHLORO-QUINOXALIN-2-YL)-AMIDE; sym-Tribromoaniline; EINECS 205-700-1; MFCD00007634; Aniline tribromide; s-Tribromoaniline; 2,4,6-tribromo-aniline; 2,4,6-Tribromophenylamine; 2,4,6-tribromaniline; (2,4,6-Tribromophenyl)amine |
| Molecular Formula | C6H4Br3N |
| Molecular Weight | 335.77 |
| Purity | 98.00 |
| Density | 2.4±0.1 g/cm3 |
| Boiling Point | 300.0±0.0 °C at 760 mmHg |
| Melting Point | 120-122 °C(lit.) |
| Appearance | white crystal |
| Storage Condition | Store in a dry and cool place. |
| Packaging | I; II; III |
| HTC | 2921420090 |
| UN(IATA) | UN 无资料 |
| PubChem ID | 329759682 |
| MDL Number | MFCD04118303 |
| SMILES | N[13c]1[13c](Br)[13cH][13c](Br)[13cH][13c]1Br |
| InChI | 1S/C6H4Br3N/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChI Key | GVPODVKBTHCGFU-IDEBNGHGSA-N |
| UNSPSC | 12352101 |
| Hazard Symbols | 6.1 |
| MSDS | msds/20975_1_147_82_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Xanthosine | 146-80-5 | 2A-9020968 |
| Copper phthalocyanine | 147-14-8 | 2A-9020970 |
| Diphenhydramine hydrochloride | 147-24-0 | 2A-9020971 |
| D-Tartaric acid | 147-71-7 | 2A-9020973 |
| DL-Arabinose | 147-81-9 | 2A-9020974 |
| L-Proline | 147-85-3 | 2A-9020976 |
| Thiosalicylic acid | 147-93-3 | 2A-9020977 |
| Cytarabine | 147-94-4 | 2A-9020978 |
| Sodium diethyldithiocarbamate | 148-18-5 | 2A-9020980 |
| 1,8-Dihydroxynaphthylene-3,6-disulfonic acid | 148-25-4 | 2A-9020982 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA