
CAS Number69584-87-8
Synonyms2-(2,5-Difluorophenyl)acetonitrile; EINECS 274-051-4; 2,5-Difluorobenzyl cyanide; (2,5-Difluorophenyl)acetonitrile; NC1R BF EF; MFCD00009972; 2,5-Difluorobenzeneacetonitrile
Molecular FormulaC8H5F2N
Molecular Weight153.129
Purity98%
Density1.2±0.1 g/cm3
Boiling Point214.0±25.0 °C at 760 mmHg
AppearanceTransparent colorless to yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 69584-87-8 |
| Catalog No. | 2A-9002004 |
| Chinese Name | 2,5-二氟苯乙腈 |
| Synonyms | 2-(2,5-Difluorophenyl)acetonitrile; EINECS 274-051-4; 2,5-Difluorobenzyl cyanide; (2,5-Difluorophenyl)acetonitrile; NC1R BF EF; MFCD00009972; 2,5-Difluorobenzeneacetonitrile |
| Molecular Formula | C8H5F2N |
| Molecular Weight | 153.129 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 214.0±25.0 °C at 760 mmHg |
| Appearance | Transparent colorless to yellow liquid |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| Packaging | III |
| HTC | 2926909090 |
| SMILES | N#CCc1cc(F)ccc1F |
| InChI | InChI=1S/C8H5F2N/c9-7-1-2-8(10)6(5-7)3-4-11/h1-2,5H,3H2 |
| InChI Key | UIMMFRUOZOWROM-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/2004_2_69584_87_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Item 1 Poisons. UN number: 3276 Proper Shipping Name: Nitrile, Liquid, Toxic, Not Otherwise Specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,5-Difluorobenzylbromide | 85117-99-3 | 2A-9001997 |
| 2,5-Difluorobromobenzene | 399-94-0 | 2A-9001998 |
| 2,5-Difluoromandelic acid | 207853-61-0 | 2A-9002000 |
| 2,5-Difluorophenol | 2713-31-7 | 2A-9002001 |
| 2,5-Difluorophenylacetic acid | 85068-27-5 | 2A-9002003 |
| 2,5-Difluorophenylhydrazine | 97108-50-4 | 2A-9002006 |
| 2,5-Dihydroxyacetophenone | 490-78-8 | 2A-9002008 |
| 2,5-Dihydroxybenzoic acid | 490-79-9 | 2A-9002009 |
| 2,5-Dihydroxybenzoic acid sodium | 4955-90-2 | 2A-9002010 |
| 2,5-Dimethoxyacetoacetanilide | 6375-27-5 | 2A-9002013 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA