
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 99799-09-4 |
| Catalog No. | 2A-1194413 |
| Chinese Name | 4-羟基环己基乙酸 |
| Synonyms | 4-hydroxycyclohexylacetic acid; 4-hydroxy-Cyclohexane acetic acid; 4-Hydroxycyclohexylessigsaeure |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.2 |
| Density | 1.166 g/cm3 |
| Boiling Point | 326.439ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918199090 |
| PubChem ID | 35679589 |
| MDL Number | MFCD13659403 |
| InChI | InChI=1S/C8H14O3/c9-7-3-1-6(2-4-7)5-8(10)11/h6-7,9H,1-5H2,(H,10,11) |
| InChI Key | ALTAAUJNHYWOGS-UHFFFAOYSA-N |
| MSDS | msds/196038_1_99799_09_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| AS-2444697 | 1287665-60-4 | 2A-2194405 |
| NBI-31772 hydrate | 374620-70-9 | 2A-2194407 |
| 3-(3-Methoxyphenyl)-2-Methyl-N-(2-(thiazol-4-yl)-1H-benzo[d]iMidazol-5-yl)propanaMide hydrochloride | 1393748-80-5 | 2A-2194408 |
| MRTX0902 | 2654743-22-1 | 2A-2194409 |
| PF-06821497 | 1844849-10-0 | 2A-2194410 |
| TRANS-2-(4-AMINOCYCLOHEXYL)-2-HYDROXYPROPANE | 899806-45-2 | 2A-1194414 |
| ethyl 2-(4-aMinocyclohexyl)acetate | 343775-23-5 | 2A-1194420 |
| Trifluormethylcyclohexylbromid | 30129-20-5 | 2A-1194423 |
| 5-hydroxypipecolic acid | 13096-31-6 | 2A-1194432 |
| trans-4-(2-methoxypropan-2-yl)cyclohexan-1-amine | 2058249-81-1 | 2A-1194440 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA