
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 88920-24-5 |
| Catalog No. | 2A-1193114 |
| Chinese Name | (4-甲氧基苄氧基)乙酸 |
| Synonyms | 2-[(4-methoxyphenyl)methoxy]acetic acid |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20000 |
| Purity | 98.00 |
| Density | 1.198 g/cm3 |
| Boiling Point | 367.4ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| PubChem ID | 15899548 |
| SMILES | COc1ccc(COCC(=O)O)cc1 |
| InChI | InChI=1S/C10H12O4/c1-13-9-4-2-8(3-5-9)6-14-7-10(11)12/h2-5H,6-7H2,1H3,(H,11,12) |
| InChI Key | XNXTXCKLOBWPQA-UHFFFAOYSA-N |
| MSDS | msds/194678_1_88920_24_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2H-Pyran-3(6H)-one | 98166-23-5 | 2A-1193089 |
| (4-bromothiazol-2-yl)methanamine hydrochloride | 1207175-70-9 | 2A-1193097 |
| 1,5-Naphthyridin-4-amine,6-methoxy-(9CI) | 249889-69-8 | 2A-1193098 |
| 1,4,4-Trimethyl-6-nitro-3,4-dihydro-1H-quinolin-2-one | 144583-89-1 | 2A-1193103 |
| 5-chloro-1-phenylpentan-1-one | 942-93-8 | 2A-1193107 |
| Alcohols, C9-11, ethoxylated propoxylated | 103818-93-5 | 2A-1193115 |
| 3,5-Difluoro-D-phenylalanine | 266360-63-8 | 2A-1193116 |
| ROLIPRAM | 61413-54-5 | 2A-1193117 |
| DICHLOROACETIC ANHYDRIDE | 4124-30-5 | 2A-1193116 |
| FLURANDRENOLONE ACETATE | 2802-11-1 | 2A-1193119 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA