
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 942-93-8 |
| Catalog No. | 2A-1193107 |
| Chinese Name | 5-chloro-1-phenylpentan-1-one |
| Synonyms | 5-CHLORO-1-OXO-1-PHENYLPENTANE; phenyl 4-chlorobutyl ketone; 5-Chloro-1-phenyl-1-pentanone |
| Molecular Formula | C11H13O1Cl1 |
| Molecular Weight | 196.68 |
| Density | 1.081g/cm3 |
| Boiling Point | 304.5ºC at 760mmHg |
| HTC | 2914700090 |
| PubChem ID | 4997648 |
| MDL Number | MFCD00039390 |
| SMILES | O=C(CCCCCl)c1ccccc1 |
| InChI | InChI=1S/C11H13ClO/c12-9-5-4-8-11(13)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2 |
| InChI Key | HTQNQSPMTCJERU-UHFFFAOYSA-N |
| MSDS | msds/194671_1_942_93_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| METHYL 3,5-DIMETHYLBENZOATE | 25081-39-4 | 2A-1193084 |
| 2H-Pyran-3(6H)-one | 98166-23-5 | 2A-1193089 |
| (4-bromothiazol-2-yl)methanamine hydrochloride | 1207175-70-9 | 2A-1193097 |
| 1,5-Naphthyridin-4-amine,6-methoxy-(9CI) | 249889-69-8 | 2A-1193098 |
| 1,4,4-Trimethyl-6-nitro-3,4-dihydro-1H-quinolin-2-one | 144583-89-1 | 2A-1193103 |
| (4-Methoxybenzyloxy)acetic acid | 88920-24-5 | 2A-1193114 |
| Alcohols, C9-11, ethoxylated propoxylated | 103818-93-5 | 2A-1193115 |
| 3,5-Difluoro-D-phenylalanine | 266360-63-8 | 2A-1193116 |
| ROLIPRAM | 61413-54-5 | 2A-1193117 |
| DICHLOROACETIC ANHYDRIDE | 4124-30-5 | 2A-1193116 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA