
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1501-04-8 |
| Catalog No. | 2A-1190901 |
| Chinese Name | 4-苯甲酰基丁酸甲酯 |
| Synonyms | Methyl 5-oxo-5-phenylpentanoate; Benzenepentanoic acid, δ-oxo-, methyl ester; 1OV3VR; METHYL 4-BENZOYLBUTYRATE |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 322.4±25.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2918300090 |
| PubChem ID | 10244890 |
| SMILES | COC(=O)CCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14O3/c1-15-12(14)9-5-8-11(13)10-6-3-2-4-7-10/h2-4,6-7H,5,8-9H2,1H3 |
| InChI Key | GRIWFUFDJOESIC-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Difluoro-4-nitrobenzonitrile | 1123172-88-2 | 2A-1190895 |
| 7,4'-DIHYDROXYFLAVONE | 2196-14-7 | 2A-1190894 |
| Dichloro[2,2]paracyclophane | 10366-05-9 | 2A-1190899 |
| 2-Fluoro-5-[(methylsulfonyl)amino]-benzoicacid | 137315-01-6 | 2A-1190900 |
| 6,4'-Dimethoxy flavanone | 6336-07-8 | 2A-1190899 |
| 3',4'-Dimethoxy flavanone | 6344-21-4 | 2A-1190901 |
| (4-CHLORO-PHENYL)-PROPYNOIC ACID ETHYL ESTER | 20026-96-4 | 2A-1190902 |
| 2-Fluoro-4-(trifluoroMethoxy)aniline | 123572-58-7 | 2A-1190903 |
| 4'-Hydroxy-5,7-dimethoxy flavanone | 2A-1190902 | 2A-1190902 |
| 4'-Hydroxy flavanone | 6515-37-3 | 2A-1190904 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA