
CAS Number20026-96-4
Synonymsethyl 3-(4-chlorophenyl)prop-2-ynoate; 3-(4-chlorophenyl)propiolate; ethyl 4-chlorophenylpropiolate; ethyl 4-chlorophenylpropynoate; (4-chloro-phenyl)-propynoic acid ethyl ester; 2-Propynoic acid, 3-(4-chlorophenyl)-, ethyl ester; Ethyl 3-(4-chlorophenyl)propiolate; (4-Chlor-phenyl)-propiolsaeure-aethylester; Ethyl 3-(4-chlorophenyl)-2-propynoate
Molecular FormulaC11H9O2Cl1
Molecular Weight208.64
Density1.2±0.1 g/cm3
Boiling Point293.5±23.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20026-96-4 |
| Catalog No. | 2A-1190902 |
| Chinese Name | (4-氯苯基)-丙酸乙酯 |
| Synonyms | ethyl 3-(4-chlorophenyl)prop-2-ynoate; 3-(4-chlorophenyl)propiolate; ethyl 4-chlorophenylpropiolate; ethyl 4-chlorophenylpropynoate; (4-chloro-phenyl)-propynoic acid ethyl ester; 2-Propynoic acid, 3-(4-chlorophenyl)-, ethyl ester; Ethyl 3-(4-chlorophenyl)propiolate; (4-Chlor-phenyl)-propiolsaeure-aethylester; Ethyl 3-(4-chlorophenyl)-2-propynoate |
| Molecular Formula | C11H9O2Cl1 |
| Molecular Weight | 208.64 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 293.5±23.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2916399090 |
| PubChem ID | 593937 |
| MDL Number | MFCD00456510 |
| SMILES | CCOC(=O)C#Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H9ClO2/c1-2-14-11(13)8-5-9-3-6-10(12)7-4-9/h3-4,6-7H,2H2,1H3 |
| InChI Key | PSAMQLWFJMRMOG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dichloro[2,2]paracyclophane | 10366-05-9 | 2A-1190899 |
| 2-Fluoro-5-[(methylsulfonyl)amino]-benzoicacid | 137315-01-6 | 2A-1190900 |
| 6,4'-Dimethoxy flavanone | 6336-07-8 | 2A-1190899 |
| METHYL 4-BENZOYLBUTYRATE | 1501-04-8 | 2A-1190901 |
| 3',4'-Dimethoxy flavanone | 6344-21-4 | 2A-1190901 |
| 2-Fluoro-4-(trifluoroMethoxy)aniline | 123572-58-7 | 2A-1190903 |
| 4'-Hydroxy-5,7-dimethoxy flavanone | 2A-1190902 | 2A-1190902 |
| 4'-Hydroxy flavanone | 6515-37-3 | 2A-1190904 |
| 5,7,4'-Trimethoxy flavanone | 38302-15-7 | 2A-1190905 |
| 2-PROPENYLTRIMETHYLSILANE | 18163-07-0 | 2A-1190906 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA