
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6373-73-5 |
| Catalog No. | 2A-1190888 |
| Chinese Name | 分散黄9 |
| Synonyms | 4-N-(2,4-dinitrophenyl)benzene-1,4-diamine; EINECS 228-919-4; MFCD00007851 |
| Molecular Formula | (O2N)2C6H3NHC6H4NH2 |
| Molecular Weight | 274.23 |
| Purity | 98.00 |
| Density | 1.511g/cm3 |
| Boiling Point | 466ºC at 760 mmHg |
| Melting Point | 187-190ºC(lit.) |
| Storage Condition | Store in an airtight, cool and dry place, ensuring |
| EINECS | 228-919-4 |
| HTC | 2921590090 |
| PubChem ID | 329755766 |
| MDL Number | MFCD00007851 |
| SMILES | Nc1ccc(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H10N4O4/c13-8-1-3-9(4-2-8)14-11-6-5-10(15(17)18)7-12(11)16(19)20/h1-7,14H,13H2 |
| InChI Key | JMDHCJDATBJFJS-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 85151701 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pigments & Additives | ||
|---|---|---|
| 5(6)-Carboxytetramethylrhodamine | 98181-63-6 | 2A-2187493 |
| 6-Carboxytetramethylrhodamine succinimidyl ester | 150810-69-8 | 2A-2187496 |
| 6-Carboxytetramethylrhodamine | 91809-67-5 | 2A-2187507 |
| DISPERSE BLUE 106 | 12223-01-7 | 2A-2187821 |
| 2,5-Di(HD)-3,6-di(5-broMothiophen)diketopyrrolopyrrole | 1000623-98-2 | 2A-1190022 |
| Disperse Blue 124 | 15141-18-1 | 2A-1190889 |
| DISPERSE BLUE 26 | 3860-63-7 | 2A-1190890 |
| METHYLENE BLUE | 122965-43-9 | 2A-1191229 |
| Pigment Yellow 176 | 90268-24-9 | 2A-1191465 |
| Disperse Yellow 114 | 61968-66-9 | 2A-1191480 |
| Browse all Pigments & Additives products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA