
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 504-99-4 |
| Catalog No. | 2A-2181337 |
| Chinese Name | 6-甲基正辛酸 |
| Synonyms | d-6-Methyloctanoic acid; Octanoic acid,6-methyl; d-6-methyl-octanoic acid; 6-Methyloctanoic acid; 6-methyl-octanoic acid |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 253.4±8.0 °C at 760 mmHg |
| Appearance | liquid |
| Storage Condition | room temperature |
| HTC | 2915900090 |
| PubChem ID | 7849694 |
| MDL Number | MFCD02258713 |
| SMILES | CCC(C)CCCCC(=O)O |
| InChI | InChI=1S/C9H18O2/c1-3-8(2)6-4-5-7-9(10)11/h8H,3-7H2,1-2H3,(H,10,11) |
| InChI Key | GPOPHQSTNHUENT-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-METHYLHEXANOIC ACID | 1561-11-1 | 2A-2181330 |
| METHAPYRILENE HYDROCHLORIDE | 135-23-9 | 2A-2181331 |
| 3-NITROPROPIONIC ACID | 504-88-1 | 2A-1181333 |
| 9-oxodecanoic acid | 1422-26-0 | 2A-2181333 |
| 10-Oxoundecanoic acid | 676-00-6 | 2A-2181334 |
| 4-[(4-chloro-2-nitrophenyl)azo]-3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide | 6471-50-7 | 2A-2181338 |
| Terephthalic acid, monohydroxyethyl ester sodium salts Terephthalic acid,monohydroxyethyl ester sodium salts | 1137-99-1 | 2A-2181339 |
| Cupric chloride dihydrate | 1344-67-8 | 2A-3181340 |
| 2-butoxyethyl 2-ethoxyethyl ether | 3895-17-8 | 2A-2181340 |
| 1-Butoxy-2-ethoxyethane | 4413-13-2 | 2A-2181341 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA