
CAS Number1137-99-1
Synonyms1,4-Benzenedicarboxylic acid,mono(2-hydroxyethyl) ester; Ethylene terephthalate; glycol monoesters of terephthalic acid; glycol terephthalate; <2-Hydroxy-aethyl>-hydrogenterephthalat; terephthalic acid mono-(2-hydroxy-ethyl ester); Terephthalsaeure-mono-(2-hydroxy-aethylester)
Molecular FormulaC10H9O5
Molecular Weight210.19
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1137-99-1 |
| Catalog No. | 2A-2181339 |
| Chinese Name | 4-((2-羟乙氧基)羰基)苯甲酸 |
| Synonyms | 1,4-Benzenedicarboxylic acid,mono(2-hydroxyethyl) ester; Ethylene terephthalate; glycol monoesters of terephthalic acid; glycol terephthalate; <2-Hydroxy-aethyl>-hydrogenterephthalat; terephthalic acid mono-(2-hydroxy-ethyl ester); Terephthalsaeure-mono-(2-hydroxy-aethylester) |
| Molecular Formula | C10H9O5 |
| Molecular Weight | 210.19 |
| Storage Condition | Room temperature, dry, sealed |
| HTC | 2918990090 |
| PubChem ID | 6102876 |
| SMILES | O=C(O)c1ccc(C(=O)OCCO)cc1 |
| InChI | InChI=1S/C10H10O5/c11-5-6-15-10(14)8-3-1-7(2-4-8)9(12)13/h1-4,11H,5-6H2,(H,12,13) |
| InChI Key | BCBHDSLDGBIFIX-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-NITROPROPIONIC ACID | 504-88-1 | 2A-1181333 |
| 9-oxodecanoic acid | 1422-26-0 | 2A-2181333 |
| 10-Oxoundecanoic acid | 676-00-6 | 2A-2181334 |
| 6-METHYLOCTANOIC ACID | 504-99-4 | 2A-2181337 |
| 4-[(4-chloro-2-nitrophenyl)azo]-3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide | 6471-50-7 | 2A-2181338 |
| Cupric chloride dihydrate | 1344-67-8 | 2A-3181340 |
| 2-butoxyethyl 2-ethoxyethyl ether | 3895-17-8 | 2A-2181340 |
| 1-Butoxy-2-ethoxyethane | 4413-13-2 | 2A-2181341 |
| N'-(4-methoxy-benzyl)-N,N-dimethyl-ethylenediamine | 65875-39-0 | 2A-2181343 |
| 3-HYDROXYOCTADECANOIC ACID | 45261-96-9 | 2A-2181344 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA