
CAS Number72256-95-2
SynonymsWSGR BE DE; 2,4-Dibromobenzenesulphonyl chloride; 2,4-Dibromobenzenesulfonyl chloride; MFCD03093759
Molecular FormulaC6H3Br2ClO2S
Molecular Weight334.413
Purity98%
Density2.1±0.1 g/cm3
Boiling Point338.6±27.0 °C at 760 mmHg
Melting Point82-86 °C(lit.)
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 72256-95-2 |
| Catalog No. | 2A-9001819 |
| Chinese Name | 2,4-二溴苯磺酰氯 |
| Synonyms | WSGR BE DE; 2,4-Dibromobenzenesulphonyl chloride; 2,4-Dibromobenzenesulfonyl chloride; MFCD03093759 |
| Molecular Formula | C6H3Br2ClO2S |
| Molecular Weight | 334.413 |
| Purity | 98 |
| Density | 2.1±0.1 g/cm3 |
| Boiling Point | 338.6±27.0 °C at 760 mmHg |
| Melting Point | 82-86 °C(lit.) |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| Packaging | II |
| HTC | 2904909090 |
| SMILES | O=S(=O)(Cl)c1ccc(Br)cc1Br |
| InChI Key | OMOXIKAWVFDFNX-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/1819_1_72256_95_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Diaminophenoxyethanol sulfate | 70643-20-8 | 2A-9001814 |
| 2,4-Dibromo-1-fluorobenzene | 1435-53-6 | 2A-9001815 |
| 2,4-Dibromo-3-(difluoromethoxy)benzoic acid | 223595-28-6 | 2A-9001816 |
| 2,4-Dibromo-6-(trifluoromethyl)aniline | 71757-14-7 | 2A-9001817 |
| 2,4-Dibromo-6-fluoroaniline | 141474-37-5 | 2A-9001818 |
| 2,4-Dibromophenoxyacetic acid | 10129-78-9 | 2A-9001820 |
| 2,4-Dibromothiazole | 4175-77-3 | 2A-9001821 |
| 2,4-Dichloro-1-(2-propynyloxy)benzene | 17061-90-4 | 2A-9001822 |
| 2,4-Dichloro-3,5-dinitrobenzamide | 13550-88-4 | 2A-9001823 |
| 2,4-Dichloro-3,5-dinitrobenzoic acid | 52729-03-0 | 2A-9001824 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA