
CAS Number70643-20-8
Synonyms2-(2,4-Diaminophenoxy)ethanol sulfate (1:1); 4-(2-Hydroxyethoxy)benzene-1,3-diaminium sulfate; EINECS 274-713-2; Ethanol, 2-(2,4-diaminophenoxy)-, sulfate (1:1) (salt); MFCD00035495; 2-(2,4-diaminophenoxy)ethanol,sulfuric acid
Molecular FormulaC8H14N2O6S
Molecular Weight266.272
Purity98%
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 70643-20-8 |
| Catalog No. | 2A-9001814 |
| Chinese Name | 2,4-二氨基苯氧基乙醇硫酸盐 |
| Synonyms | 2-(2,4-Diaminophenoxy)ethanol sulfate (1:1); 4-(2-Hydroxyethoxy)benzene-1,3-diaminium sulfate; EINECS 274-713-2; Ethanol, 2-(2,4-diaminophenoxy)-, sulfate (1:1) (salt); MFCD00035495; 2-(2,4-diaminophenoxy)ethanol,sulfuric acid |
| Molecular Formula | C8H14N2O6S |
| Molecular Weight | 266.272 |
| Purity | 98 |
| Storage Condition | 2-8°C |
| HTC | 2922509090 |
| SMILES | Nc1ccc(OCCO)c(N)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H12N2O2/c9-6-1-2-8(7(10)5-6)12-4-3-11/h1-2,5,11H,3-4,9-10H2 |
| InChI Key | UUHBEKCQQLDQNG-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Diamino-6-(4-fluorophenyl)pyrimidine | 175137-25-4 | 2A-9001809 |
| 2,4-Diamino-6-hydroxymethylpteridine | 73978-41-3 | 2A-0202378 |
| 2,4-Diamino-6-mercaptopyrimidine | 56-08-6 | 2A-9001811 |
| 2,4-Diaminofluorobenzene | 6264-67-1 | 2A-9001812 |
| 2,4-Diaminomesitylene | 3102-70-3 | 2A-9001813 |
| 2,4-Dibromo-1-fluorobenzene | 1435-53-6 | 2A-9001815 |
| 2,4-Dibromo-3-(difluoromethoxy)benzoic acid | 223595-28-6 | 2A-9001816 |
| 2,4-Dibromo-6-(trifluoromethyl)aniline | 71757-14-7 | 2A-9001817 |
| 2,4-Dibromo-6-fluoroaniline | 141474-37-5 | 2A-9001818 |
| 2,4-Dibromobenzenesulphonyl chloride | 72256-95-2 | 2A-9001819 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA