
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52729-03-0 |
| Catalog No. | 2A-9001824 |
| Chinese Name | 2,4-二氯-3,5-二硝基苯甲酸 |
| Synonyms | 2,4-dichloro-3,5-dinitrobenzoic acid; MFCD00010131; EINECS 258-136-3 |
| Molecular Formula | C7H2Cl2N2O6 |
| Molecular Weight | 281.01 |
| Purity | 95 |
| Density | 1.879g/cm3 |
| Boiling Point | 433.7ºC at 760mmHg |
| Melting Point | 212-213 °C(lit.) |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2916399090 |
| MDL Number | MFCD00024184 |
| SMILES | O=C(O)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C7H2Cl2N2O6/c8-4-2(7(12)13)1-3(10(14)15)5(9)6(4)11(16)17/h1H,(H,12,13) |
| InChI Key | OCJYCLPVZHBZRL-UHFFFAOYSA-N |
| MSDS | msds/1824_1_52729_03_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dibromobenzenesulphonyl chloride | 72256-95-2 | 2A-9001819 |
| 2,4-Dibromophenoxyacetic acid | 10129-78-9 | 2A-9001820 |
| 2,4-Dibromothiazole | 4175-77-3 | 2A-9001821 |
| 2,4-Dichloro-1-(2-propynyloxy)benzene | 17061-90-4 | 2A-9001822 |
| 2,4-Dichloro-3,5-dinitrobenzamide | 13550-88-4 | 2A-9001823 |
| 2,4-Dichloro-3,5-dinitrobenzotrifluoride | 29091-09-6 | 2A-9001825 |
| 2,4-Dichloro-3-ethyl-6-nitrophenol | 99817-36-4 | 2A-9001826 |
| 2,4-Dichloro-3-fluorobenzonitrile | 161612-68-6 | 2A-9001827 |
| 2,4-Dichloro-3-fluoronitrobenzene | 393-79-3 | 2A-9001828 |
| 2,4-Dichloro-3-nitro-5-methylbenzotrifluoride | 115571-69-2 | 2A-9001829 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA