
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 105471-98-5 |
| Catalog No. | 2A-1179290 |
| Chinese Name | 木通苯乙醇苷B |
| Synonyms | 2-(3,4-Dihydroxyphenyl)ethyl 6-O-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoyl]-β-D-glucopyranoside |
| Molecular Formula | C23H26O11 |
| Molecular Weight | 478.45 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 799.8±60.0 °C at 760 mmHg |
| Storage Condition | 2~8℃ |
| Application | Calceolarioside B is a natural product isolated from the leaves of Stauntonia hexaphylla. Calceolarioside B has significant inhibitory activity against rat lens aldose reductase (RLAR) with an IC50 va |
| PubChem ID | 7839624 |
| MDL Number | MFCD22125003 |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OCC1OC(OCCc2ccc(O)c(O)c2)C(O)C(O)C1O |
| InChI | InChI=1S/C23H26O11/c24-14-4-1-12(9-16(14)26)3-6-19(28)33-11-18-20(29)21(30)22(31)23(34-18)32-8-7-13-2-5-15(25)17(27)10-13/h1-6,9-10,18,20-27,29-31H,7-8,11H2/b6-3+/t18-,20-,21+,22-,23-/m1/s1 |
| InChI Key | LFKQVVDFNHDYNK-FOXCETOMSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Transport Info | Product name: Akebia phenylethanoid glycoside B |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| GLUCORAPHANIN | 21414-41-5 | 2A-1177820 |
| 1-amino-4-chloro-2-methylanthraquinone | 3225-97-6 | 2A-2178179 |
| 24-Hydroxycholesterol | 30271-38-6 | 2A-2178196 |
| Silodosin glucuronide | 879396-70-0 | 2A-3178387 |
| HYPERFORIN | 11079-53-1 | 2A-2179034 |
| 25-HydroxyluMisterol3 | 61585-29-3 | 2A-3179321 |
| 25-Hydroxytachysterol3 | 39932-44-0 | 2A-3179323 |
| Forsythoside I | 1177581-50-8 | 2A-1179540 |
| Forsythoside E | 93675-88-8 | 2A-1179541 |
| Forsythoside B | 81525-13-5 | 2A-1179542 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA