
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 81525-13-5 |
| Catalog No. | 2A-1179542 |
| Chinese Name | 连翘酯苷B |
| Synonyms | Forsythoside B |
| Molecular Formula | C34H44O19 |
| Molecular Weight | 756.70 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 1040.3±65.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| Application | Forsythoside B is a phenylethanol glycoside isolated from the unique leaves of the traditional Chinese medicinal plant. It can be used to treat inflammatory diseases and promote blood circulation. For |
| HTC | 29389090 |
| PubChem ID | 47731009 |
| MDL Number | MFCD03424245 |
| SMILES | CC1OC(OC2C(O)C(OCCc3ccc(O)c(O)c3)OC(COC3OCC(O)(CO)C3O)C2OC(=O)C=Cc2ccc(O)c(O)c2)C(O)C(O)C1O |
| InChI | InChI=1S/C34H44O19/c1-15-24(41)25(42)26(43)32(50-15)53-29-27(44)31(47-9-8-17-3-6-19(37)21(39)11-17)51-22(12-48-33-30(45)34(46,13-35)14-49-33)28(29)52-23(40)7-4-16-2-5-18(36)20(38)10-16/h2-7,10-11,15,22,24-33,35-39,41-46H,8-9,12-14H2,1H3/b7-4+/t15-,22+,24-,25+,26+,27+,28+,29+,30-,31+,32-,33+,34+/m0/s1 |
| InChI Key | JMBINOWGIHWPJI-UNSOMVRXSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Transport Info | Product name: Forsythiaside B |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| Desrhamnosyl isoacteoside | 105471-98-5 | 2A-1179290 |
| 25-HydroxyluMisterol3 | 61585-29-3 | 2A-3179321 |
| 25-Hydroxytachysterol3 | 39932-44-0 | 2A-3179323 |
| Forsythoside I | 1177581-50-8 | 2A-1179540 |
| Forsythoside E | 93675-88-8 | 2A-1179541 |
| 4-METHYLUMBELLIFERONE SODIUM SALT | 5980-33-6 | 2A-3179698 |
| ANTHRAQUINONE-2,3-DICARBOXYLIC ACID | 27485-15-0 | 2A-2180487 |
| HEPTYL-BETA-D-GLUCOPYRANOSIDE | 78617-12-6 | 2A-4180921 |
| N-OCTYL ALPHA-D-GLUCOPYRANOSIDE | 29781-80-4 | 2A-4180922 |
| N-DODECYL A-D-GLUCOPYRANOSIDE | 29980-16-3 | 2A-4180923 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA