
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21045-62-5 |
| Catalog No. | 2A-4178452 |
| Chinese Name | 4-二乙氨基-1,1,1-三氟-3-丁烯-2-酮 |
| Synonyms | 4-(diethylamino)-1,1,1-trifluorobut-3-en-2-one |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 |
| Purity | 98% |
| Density | 1.115g/cm3 |
| Boiling Point | 97-98ºC 2mm |
| Melting Point | 41986ºC |
| Appearance | solid |
| HTC | 2922399090 |
| PubChem ID | 329793966 |
| MDL Number | MFCD00115108 |
| SMILES | CCN(CC)/C=C/C(C(F)(F)F)=O |
| InChI | 1S/C8H12F3NO/c1-3-12(4-2)6-5-7(13)8(9,10)11/h5-6H,3-4H2,1-2H3/b6-5+ |
| InChI Key | QKPHMBNBSBNCJN-AATRIKPKSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/179095_1_21045_62_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzene, 1-(2-chloroethyl)-4-octyl- | 849818-29-7 | 2A-4178443 |
| 4-N-OCTYLSTYRENE | 46745-66-8 | 2A-4178446 |
| 1-methyl-4-[(4-methylphenyl)sulfonyloxymethoxysulfonyl]benzene | 24124-59-2 | 2A-4178447 |
| AA2CL5CA | 52332-21-7 | 2A-4178449 |
| 5-(4-BROMOPHENYL)-5-OXOVALERIC ACID | 35333-26-7c | 2A-4178451 |
| 3,3'-AZODIBENZOIC ACID | 621-18-1 | 2A-4178453 |
| Fast Red Base DB-90 | 2A-4178454 | 2A-4178454 |
| N,N'-(3-Fluoro-4-methyl-8-oxo-5,6,7,8-tetrahydronaphthalene-1,7-diyl)diacetamide | 143655-70-3 | 2A-4178455 |
| Thiorphan | 76721-89-6 | 2A-3178446 |
| Tolterodine Acid (as racemate) | 194482-44-5 | 2A-3178465 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA