
CAS Number35333-26-7c
Synonyms4-(4-bromobenzoyl)butyric acid; 5-(4-bromophenyl)-5-oxo-pentanoic acid; 5-(4-BROMOPHENYL)-5-OXOVALERIC ACID; p-Brombenzoyl-buttersaeure; 4-(p-bromobenzoyl)butyric acid
Molecular FormulaC11H13O2Br1
Molecular Weight257.13
Purity98%%
Density1.495g/cm3
Boiling Point442.323ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35333-26-7c |
| Catalog No. | 2A-4178451 |
| Chinese Name | 5-(4-溴苯基)-5-氧代戊酸 |
| Synonyms | 4-(4-bromobenzoyl)butyric acid; 5-(4-bromophenyl)-5-oxo-pentanoic acid; 5-(4-BROMOPHENYL)-5-OXOVALERIC ACID; p-Brombenzoyl-buttersaeure; 4-(p-bromobenzoyl)butyric acid |
| Molecular Formula | C11H13O2Br1 |
| Molecular Weight | 257.13 |
| Purity | 98% |
| Density | 1.495g/cm3 |
| Boiling Point | 442.323ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918300090 |
| MDL Number | MFCD09890955 |
| SMILES | O=C(O)CCCC(=O)c1ccc(Br)cc1 |
| InChI Key | YWKKQTFYOQBCBE-UHFFFAOYSA-N |
| MSDS | msds/179094_1_35333_26_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Terbinafine-N-oxide | 2A-3178443 | 2A-3178443 |
| Benzene, 1-(2-chloroethyl)-4-octyl- | 849818-29-7 | 2A-4178443 |
| 4-N-OCTYLSTYRENE | 46745-66-8 | 2A-4178446 |
| 1-methyl-4-[(4-methylphenyl)sulfonyloxymethoxysulfonyl]benzene | 24124-59-2 | 2A-4178447 |
| AA2CL5CA | 52332-21-7 | 2A-4178449 |
| 4-DIETHYLAMINO-1,1,1-TRIFLUOROBUT-3-EN-2-ONE | 21045-62-5 | 2A-4178452 |
| 3,3'-AZODIBENZOIC ACID | 621-18-1 | 2A-4178453 |
| Fast Red Base DB-90 | 2A-4178454 | 2A-4178454 |
| N,N'-(3-Fluoro-4-methyl-8-oxo-5,6,7,8-tetrahydronaphthalene-1,7-diyl)diacetamide | 143655-70-3 | 2A-4178455 |
| Thiorphan | 76721-89-6 | 2A-3178446 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA