CAS Number89-71-4
Synonyms2-METHYL METHYLBENZOATE; RARECHEM AL BF 0047; methyl o-methylbenzoate; Methyl methylbenzoate; O-TOLUIC ACID, METHYL ESTER; EINECS 201-932-2; Methyl 2-methylbenzoate; O-TOLUIC ACID METHYL ESTER; METHYL 2-TOLUATE; Methyl-o-tolulate; MFCD00008428; Methylo-toluate; Benzoic acid, 2-methyl-, methyl ester; METHYL-O-METHYL BENZOATE; Benzoic acid, methyl-, methyl ester; Methyl orthotoluate; 2-Methyl-benzoic acid methyl ester
Molecular FormulaCH3C6H3(NO2)CO2CH3
Molecular Weight195.17
Purity97%
Density1.0±0.1 g/cm3
Boiling Point215.0±0.0 °C at 760 mmHg
Melting Point62-65 °C (lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 89-71-4 |
| Catalog No. | 2A-9017626 |
| Chinese Name | 邻甲基苯甲酸甲酯 |
| Synonyms | 2-METHYL METHYLBENZOATE; RARECHEM AL BF 0047; methyl o-methylbenzoate; Methyl methylbenzoate; O-TOLUIC ACID, METHYL ESTER; EINECS 201-932-2; Methyl 2-methylbenzoate; O-TOLUIC ACID METHYL ESTER; METHYL 2-TOLUATE; Methyl-o-tolulate; MFCD00008428; Methylo-toluate; Benzoic acid, 2-methyl-, methyl ester; METHYL-O-METHYL BENZOATE; Benzoic acid, methyl-, methyl ester; Methyl orthotoluate; 2-Methyl-benzoic acid methyl ester |
| Molecular Formula | CH3C6H3(NO2)CO2CH3 |
| Molecular Weight | 195.17 |
| Purity | 97 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 215.0±0.0 °C at 760 mmHg |
| Melting Point | 62-65 °C (lit.) |
| Appearance | solid |
| Storage Condition | This product should be sealed and stored in a cool |
| HTC | 2916399090 |
| PubChem ID | 24862702 |
| MDL Number | MFCD00082564 |
| SMILES | COC(=O)c1cccc(c1C)[N+]([O-])=O |
| InChI | 1S/C9H9NO4/c1-6-7(9(11)14-2)4-3-5-8(6)10(12)13/h3-5H,1-2H3 |
| InChI Key | CRZGFIMLHZTLGT-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1964020 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/17626_1_89_71_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Acetylanthranilic acid | 89-52-1 | 2A-9017611 |
| 5-Amino-2-chlorobenzoic acid | 89-54-3 | 2A-9017612 |
| 5-Bromosalicylic acid | 89-55-4 | 2A-0201446 |
| 5-Aminosalicylic acid | 89-57-6 | 2A-9017615 |
| 4-Methyl-2-nitroaniline | 89-62-3 | 2A-9017620 |
| 2-sec-Butylphenol | 89-72-5 | 2A-9017627 |
| Salicylhydroxamic acid | 89-73-6 | 2A-9017628 |
| Menthone | 89-80-5 | 2A-9017633 |
| 4-Nitro-1,3-dimethylbenzene | 89-87-2 | 2A-9017637 |
| Methyl dimethoxyacetate | 89-91-8 | 2A-9017638 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS