CAS Number89-62-3
SynonymsMNPT; p-Me,o-NO2-aniline; ZR D1 BNW; 1-Amino-4-methyl-2-nitrobenzene; 2-Nitro-p-toluidine; 4-methyl-2-nitrophenylamine; MFCD00057926; Fast Red GL; 4-Methyl-2-nitrobenzenamine; 3-Nitro-4-toluidine; 1-amino-2-nitro-4-methylbenzene; 4-Methyl-2-nitroaniline; 3-nitro-4-amino-toluene; 4-Amino-3-nitrotoluene; 2-nitro-4-methyl-aniline; o-nitro-p-methylaniline; EINECS 201-924-9; Fast Red GL Base; p-Toluidine,2-nitro
Molecular FormulaCH3C6H3(NO2)NH2
Molecular Weight152.15
Purity98%
Density1.3±0.1 g/cm3
Boiling Point302.9±22.0 °C at 760 mmHg
Melting Point115-116 °C (lit.)
Appearanceorange powder
EINECS201-924-9
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 89-62-3 |
| Catalog No. | 2A-9017620 |
| Chinese Name | 4-甲基-2-硝基苯胺 |
| Synonyms | MNPT; p-Me,o-NO2-aniline; ZR D1 BNW; 1-Amino-4-methyl-2-nitrobenzene; 2-Nitro-p-toluidine; 4-methyl-2-nitrophenylamine; MFCD00057926; Fast Red GL; 4-Methyl-2-nitrobenzenamine; 3-Nitro-4-toluidine; 1-amino-2-nitro-4-methylbenzene; 4-Methyl-2-nitroaniline; 3-nitro-4-amino-toluene; 4-Amino-3-nitrotoluene; 2-nitro-4-methyl-aniline; o-nitro-p-methylaniline; EINECS 201-924-9; Fast Red GL Base; p-Toluidine,2-nitro |
| Molecular Formula | CH3C6H3(NO2)NH2 |
| Molecular Weight | 152.15 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 302.9±22.0 °C at 760 mmHg |
| Melting Point | 115-116 °C (lit.) |
| Appearance | orange powder |
| Water Solubility | Soluble in: methanol |
| Storage Condition | This product should be stored in a sealed, cool, d |
| Packaging | III |
| EINECS | 201-924-9 |
| HTC | 29214300 |
| PubChem ID | 24897060 |
| MDL Number | MFCD00007907 |
| SMILES | Cc1ccc(N)c(c1)[N+]([O-])=O |
| InChI | 1S/C7H8N2O2/c1-5-2-3-6(8)7(4-5)9(10)11/h2-4H,8H2,1H3 |
| InChI Key | DLURHXYXQYMPLT-UHFFFAOYSA-N |
| Beilstein/REAXYS | 879506 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 6.1 |
| MSDS | msds/17620_1_89_62_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Methoxy-3-nitrobenzoic acid | 89-41-8 | 2A-9017607 |
| N-Acetylanthranilic acid | 89-52-1 | 2A-9017611 |
| 5-Amino-2-chlorobenzoic acid | 89-54-3 | 2A-9017612 |
| 5-Bromosalicylic acid | 89-55-4 | 2A-0201446 |
| 5-Aminosalicylic acid | 89-57-6 | 2A-9017615 |
| Methyl o-toluate | 89-71-4 | 2A-9017626 |
| 2-sec-Butylphenol | 89-72-5 | 2A-9017627 |
| Salicylhydroxamic acid | 89-73-6 | 2A-9017628 |
| Menthone | 89-80-5 | 2A-9017633 |
| 4-Nitro-1,3-dimethylbenzene | 89-87-2 | 2A-9017637 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS