
CAS Number3070-86-8
Synonymsn,n'-(oxydibenzene-4,1-diyl)diacetamide; N,N'-(Oxydi-4,1-phenylene)bisacetamide; bis(4-acetylaminophenyl) ether; N-[4-(4-acetylaminophenoxy)phenyl]acetamide; 4,4'-Oxybisacetanilide; 4,4'-diacetamido-diphenyl ether; Bis(p-acetylaminophenyl) ether; MFCD00050458; N,N'-Diacetyl-4,4'-diaminodiphenyl ether
Molecular FormulaC16H16O3N2
Molecular Weight284.31
Density1.256g/cm3
Boiling Point554.4ºC at 760mmHg
Melting Point230-231ºC(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3070-86-8 |
| Catalog No. | 2A-3175620 |
| Chinese Name | 双(对乙酰氨基苯基)醚 |
| Synonyms | n,n'-(oxydibenzene-4,1-diyl)diacetamide; N,N'-(Oxydi-4,1-phenylene)bisacetamide; bis(4-acetylaminophenyl) ether; N-[4-(4-acetylaminophenoxy)phenyl]acetamide; 4,4'-Oxybisacetanilide; 4,4'-diacetamido-diphenyl ether; Bis(p-acetylaminophenyl) ether; MFCD00050458; N,N'-Diacetyl-4,4'-diaminodiphenyl ether |
| Molecular Formula | C16H16O3N2 |
| Molecular Weight | 284.31 |
| Density | 1.256g/cm3 |
| Boiling Point | 554.4ºC at 760mmHg |
| Melting Point | 230-231ºC(lit.) |
| Storage Condition | Store in airtight, cool and dry place |
| HTC | 2924299090 |
| MDL Number | MFCD00050458 |
| SMILES | CC(=O)Nc1ccc(Oc2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C16H16N2O3/c1-11(19)17-13-3-7-15(8-4-13)21-16-9-5-14(6-10-16)18-12(2)20/h3-10H,1-2H3,(H,17,19)(H,18,20) |
| InChI Key | BUGCHAIWUSBYIZ-UHFFFAOYSA-N |
| MSDS | msds/176048_1_3070_86_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| EthanediaMide, N1-(5-chlo... | 1255529-23-7 | 2A-4175575 |
| 2-(2-fluorophenyl)-1,3-di(1H-1,2,4-triazol-1-yl)propan-2-ol | 1348664-75-4 | 2A-4175579 |
| 4,4'-iminodiphenol | 1752-24-5 | 2A-3175617 |
| Ozanimod hydrochloride | 1618636-37-5 | 2A-3175618 |
| 4-Acetoxyacetanilide | 2623-33-8 | 2A-3175619 |
| 4-[1-(hydroxyamino)ethylidene]cyclohexa-2,5-dien-1-one | 34523-34-7 | 2A-3175621 |
| TRIMETHYLQUINONE | 935-92-2 | 2A-3175623 |
| METHYL 4-METHYLCINNAMATE | 20754-20-5 | 2A-3175626 |
| β-Aspartic Acid-δ-Ornithine Dimer | 2135301-50-5 | 2A-3175627 |
| DIPHENYLCARBAZONE | 538-62-5 | 2A-1175475 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA