
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1001264-89-6 |
| Catalog No. | 2A-1175004 |
| Chinese Name | Ipatasertib |
| Synonyms | RG7440; GDC 0068; cc-616; RG 7440; GDC-0068; Ipatasertib |
| Molecular Formula | C24H32O2N5Cl1 |
| Molecular Weight | 458 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 669.4±55.0 °C at 760 mmHg |
| Appearance | powder |
| Water Solubility | Soluble in DMSO. |
| Storage Condition | -20℃ |
| Application | Ipatasertib (GDC-0068) is a selective, competitive pan-Akt inhibitor with IC50s of 5, 18, and 8 nM for Akt1, Akt2, and Akt3 inhibition, respectively. |
| PubChem ID | 49713295 |
| MDL Number | MFCD22124514 |
| SMILES | CC(C)NCC(C(=O)N1CCN(c2ncnc3c2C(C)CC3O)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H32ClN5O2/c1-15(2)26-13-19(17-4-6-18(25)7-5-17)24(32)30-10-8-29(9-11-30)23-21-16(3)12-20(31)22(21)27-14-28-23/h4-7,14-16,19-20,26,31H,8-13H2,1-3H3/t16-,19-,20-/m1/s1 |
| InChI Key | GRZXWCHAXNAUHY-NSISKUIASA-N |
| MSDS | msds/175400_1_1001264_89_6.pdf |
| Transport Info | Product name: GDC-0068 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| A66 | 1166227-08-2 | 2A-1174999 |
| OMecaMtiv Mecarbil | 873697-71-3 | 2A-1175000 |
| GW788388 | 452342-67-5 | 2A-1175001 |
| CCT 137690 | 1095382-05-0 | 2A-1175002 |
| N/A | 929016-96-6 | 2A-1175003 |
| AG 490 | 133550-30-8 | 2A-1175006 |
| WP1130 | 856243-80-6 | 2A-1175007 |
| PH 797804 | 586379-66-0 | 2A-1175008 |
| ICG-001 | 847591-62-2 | 2A-1175010 |
| TAK-700 | 426219-18-3 | 2A-1175012 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA